benzyl N-(2-hydroxy-3,5-dinitrophenyl)carbamate
Modify Date: 2026-07-31 15:07:12
benzyl N-(2-hydroxy-3,5-dinitrophenyl)carbamate structure
|
Common Name | benzyl N-(2-hydroxy-3,5-dinitrophenyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 2680824-29-5 | Molecular Weight | 333.25 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H11N3O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | benzyl N-(2-hydroxy-3,5-dinitrophenyl)carbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H11N3O7 |
|---|---|
| Molecular Weight | 333.25 |
| InChIKey | WDOJQFRKDMZZOP-UHFFFAOYSA-N |
| SMILES | O=C(Nc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O)OCc1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of benzyl N-(2-hydroxy-3,5-dinitrophenyl)carbamate? |
| A: Molecular weight of benzyl N-(2-hydroxy-3,5-dinitrophenyl)carbamate is 333.25. |
| Q: What is the English name of benzyl N-(2-hydroxy-3,5-dinitrophenyl)carbamate? |
| A: The English name of benzyl N-(2-hydroxy-3,5-dinitrophenyl)carbamate is benzyl N-(2-hydroxy-3,5-dinitrophenyl)carbamate. |
| Q: What is the SMILES notation of benzyl N-(2-hydroxy-3,5-dinitrophenyl)carbamate? |
| A: SMILES notation of benzyl N-(2-hydroxy-3,5-dinitrophenyl)carbamate is O=C(Nc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O)OCc1ccccc1. |
| Q: What is the InChIKey of benzyl N-(2-hydroxy-3,5-dinitrophenyl)carbamate? |
| A: InChIKey of benzyl N-(2-hydroxy-3,5-dinitrophenyl)carbamate is WDOJQFRKDMZZOP-UHFFFAOYSA-N. |
| Q: What is the CAS number of benzyl N-(2-hydroxy-3,5-dinitrophenyl)carbamate? |
| A: CAS number of benzyl N-(2-hydroxy-3,5-dinitrophenyl)carbamate is 2680824-29-5. |
| Q: What is the Chinese name of 2680824-29-5? |
| A: Chinese name of 2680824-29-5 is 2680824-29-5. |
| Q: What is the molecular formula of benzyl N-(2-hydroxy-3,5-dinitrophenyl)carbamate? |
| A: Molecular formula of benzyl N-(2-hydroxy-3,5-dinitrophenyl)carbamate is C14H11N3O7. |