5-{[(Benzyloxy)carbonyl]amino}-2-fluoro-4-hydroxybenzoic acid
Modify Date: 2025-11-06 15:39:37
![5-{[(Benzyloxy)carbonyl]amino}-2-fluoro-4-hydroxybenzoic acid Structure](https://www.chemsrc.com/extcaspic/156/2680834-98-2.png)
5-{[(Benzyloxy)carbonyl]amino}-2-fluoro-4-hydroxybenzoic acid structure
|
Common Name | 5-{[(Benzyloxy)carbonyl]amino}-2-fluoro-4-hydroxybenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 2680834-98-2 | Molecular Weight | 305.26 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H12FNO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-{[(Benzyloxy)carbonyl]amino}-2-fluoro-4-hydroxybenzoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H12FNO5 |
|---|---|
| Molecular Weight | 305.26 |
| InChIKey | UATKIOHNOPXPKZ-UHFFFAOYSA-N |
| SMILES | O=C(Nc1cc(C(=O)O)c(F)cc1O)OCc1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2680834-98-2? |
| A: Chinese name of 2680834-98-2 is 2680834-98-2. |
| Q: What is the molecular formula of 5-{[(Benzyloxy)carbonyl]amino}-2-fluoro-4-hydroxybenzoic acid? |
| A: Molecular formula of 5-{[(Benzyloxy)carbonyl]amino}-2-fluoro-4-hydroxybenzoic acid is C15H12FNO5. |
| Q: What is the molecular weight of 5-{[(Benzyloxy)carbonyl]amino}-2-fluoro-4-hydroxybenzoic acid? |
| A: Molecular weight of 5-{[(Benzyloxy)carbonyl]amino}-2-fluoro-4-hydroxybenzoic acid is 305.26. |
| Q: What is the SMILES notation of 5-{[(Benzyloxy)carbonyl]amino}-2-fluoro-4-hydroxybenzoic acid? |
| A: SMILES notation of 5-{[(Benzyloxy)carbonyl]amino}-2-fluoro-4-hydroxybenzoic acid is O=C(Nc1cc(C(=O)O)c(F)cc1O)OCc1ccccc1. |
| Q: What is the CAS number of 5-{[(Benzyloxy)carbonyl]amino}-2-fluoro-4-hydroxybenzoic acid? |
| A: CAS number of 5-{[(Benzyloxy)carbonyl]amino}-2-fluoro-4-hydroxybenzoic acid is 2680834-98-2. |
| Q: What is the InChIKey of 5-{[(Benzyloxy)carbonyl]amino}-2-fluoro-4-hydroxybenzoic acid? |
| A: InChIKey of 5-{[(Benzyloxy)carbonyl]amino}-2-fluoro-4-hydroxybenzoic acid is UATKIOHNOPXPKZ-UHFFFAOYSA-N. |
| Q: What is the English name of 5-{[(Benzyloxy)carbonyl]amino}-2-fluoro-4-hydroxybenzoic acid? |
| A: The English name of 5-{[(Benzyloxy)carbonyl]amino}-2-fluoro-4-hydroxybenzoic acid is 5-{[(Benzyloxy)carbonyl]amino}-2-fluoro-4-hydroxybenzoic acid. |