benzyl N-(7-bromo-5-chloro-1,3-benzothiazol-4-yl)carbamate structure
|
Common Name | benzyl N-(7-bromo-5-chloro-1,3-benzothiazol-4-yl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 2680835-46-3 | Molecular Weight | 397.7 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H10BrClN2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | benzyl N-(7-bromo-5-chloro-1,3-benzothiazol-4-yl)carbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H10BrClN2O2S |
|---|---|
| Molecular Weight | 397.7 |
| InChIKey | ZDAJMFVGIHBGDY-UHFFFAOYSA-N |
| SMILES | O=C(Nc1c(Cl)cc(Br)c2scnc12)OCc1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of benzyl N-(7-bromo-5-chloro-1,3-benzothiazol-4-yl)carbamate? |
| A: CAS number of benzyl N-(7-bromo-5-chloro-1,3-benzothiazol-4-yl)carbamate is 2680835-46-3. |
| Q: What is the molecular weight of benzyl N-(7-bromo-5-chloro-1,3-benzothiazol-4-yl)carbamate? |
| A: Molecular weight of benzyl N-(7-bromo-5-chloro-1,3-benzothiazol-4-yl)carbamate is 397.7. |
| Q: What is the SMILES notation of benzyl N-(7-bromo-5-chloro-1,3-benzothiazol-4-yl)carbamate? |
| A: SMILES notation of benzyl N-(7-bromo-5-chloro-1,3-benzothiazol-4-yl)carbamate is O=C(Nc1c(Cl)cc(Br)c2scnc12)OCc1ccccc1. |
| Q: What is the Chinese name of 2680835-46-3? |
| A: Chinese name of 2680835-46-3 is 2680835-46-3. |
| Q: What is the molecular formula of benzyl N-(7-bromo-5-chloro-1,3-benzothiazol-4-yl)carbamate? |
| A: Molecular formula of benzyl N-(7-bromo-5-chloro-1,3-benzothiazol-4-yl)carbamate is C15H10BrClN2O2S. |
| Q: What is the English name of benzyl N-(7-bromo-5-chloro-1,3-benzothiazol-4-yl)carbamate? |
| A: The English name of benzyl N-(7-bromo-5-chloro-1,3-benzothiazol-4-yl)carbamate is benzyl N-(7-bromo-5-chloro-1,3-benzothiazol-4-yl)carbamate. |
| Q: What is the InChIKey of benzyl N-(7-bromo-5-chloro-1,3-benzothiazol-4-yl)carbamate? |
| A: InChIKey of benzyl N-(7-bromo-5-chloro-1,3-benzothiazol-4-yl)carbamate is ZDAJMFVGIHBGDY-UHFFFAOYSA-N. |