ethyl 5-{[(benzyloxy)carbonyl]amino}-1-(2-hydroxyethyl)-3-methyl-1H-pyrazole-4-carboxylate
Modify Date: 2026-07-10 20:59:39
![ethyl 5-{[(benzyloxy)carbonyl]amino}-1-(2-hydroxyethyl)-3-methyl-1H-pyrazole-4-carboxylate Structure](https://www.chemsrc.com/extcaspic/376/2680835-52-1.png)
ethyl 5-{[(benzyloxy)carbonyl]amino}-1-(2-hydroxyethyl)-3-methyl-1H-pyrazole-4-carboxylate structure
|
Common Name | ethyl 5-{[(benzyloxy)carbonyl]amino}-1-(2-hydroxyethyl)-3-methyl-1H-pyrazole-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 2680835-52-1 | Molecular Weight | 347.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H21N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl 5-{[(benzyloxy)carbonyl]amino}-1-(2-hydroxyethyl)-3-methyl-1H-pyrazole-4-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H21N3O5 |
|---|---|
| Molecular Weight | 347.4 |
| InChIKey | UYODMPFYWGEKBB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c(C)nn(CCO)c1NC(=O)OCc1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of ethyl 5-{[(benzyloxy)carbonyl]amino}-1-(2-hydroxyethyl)-3-methyl-1H-pyrazole-4-carboxylate? |
| A: Molecular weight of ethyl 5-{[(benzyloxy)carbonyl]amino}-1-(2-hydroxyethyl)-3-methyl-1H-pyrazole-4-carboxylate is 347.4. |
| Q: What is the CAS number of ethyl 5-{[(benzyloxy)carbonyl]amino}-1-(2-hydroxyethyl)-3-methyl-1H-pyrazole-4-carboxylate? |
| A: CAS number of ethyl 5-{[(benzyloxy)carbonyl]amino}-1-(2-hydroxyethyl)-3-methyl-1H-pyrazole-4-carboxylate is 2680835-52-1. |
| Q: What is the SMILES notation of ethyl 5-{[(benzyloxy)carbonyl]amino}-1-(2-hydroxyethyl)-3-methyl-1H-pyrazole-4-carboxylate? |
| A: SMILES notation of ethyl 5-{[(benzyloxy)carbonyl]amino}-1-(2-hydroxyethyl)-3-methyl-1H-pyrazole-4-carboxylate is CCOC(=O)c1c(C)nn(CCO)c1NC(=O)OCc1ccccc1. |
| Q: What is the InChIKey of ethyl 5-{[(benzyloxy)carbonyl]amino}-1-(2-hydroxyethyl)-3-methyl-1H-pyrazole-4-carboxylate? |
| A: InChIKey of ethyl 5-{[(benzyloxy)carbonyl]amino}-1-(2-hydroxyethyl)-3-methyl-1H-pyrazole-4-carboxylate is UYODMPFYWGEKBB-UHFFFAOYSA-N. |
| Q: What is the English name of ethyl 5-{[(benzyloxy)carbonyl]amino}-1-(2-hydroxyethyl)-3-methyl-1H-pyrazole-4-carboxylate? |
| A: The English name of ethyl 5-{[(benzyloxy)carbonyl]amino}-1-(2-hydroxyethyl)-3-methyl-1H-pyrazole-4-carboxylate is ethyl 5-{[(benzyloxy)carbonyl]amino}-1-(2-hydroxyethyl)-3-methyl-1H-pyrazole-4-carboxylate. |
| Q: What is the molecular formula of ethyl 5-{[(benzyloxy)carbonyl]amino}-1-(2-hydroxyethyl)-3-methyl-1H-pyrazole-4-carboxylate? |
| A: Molecular formula of ethyl 5-{[(benzyloxy)carbonyl]amino}-1-(2-hydroxyethyl)-3-methyl-1H-pyrazole-4-carboxylate is C17H21N3O5. |
| Q: What is the Chinese name of 2680835-52-1? |
| A: Chinese name of 2680835-52-1 is 2680835-52-1. |