benzyl N-[4-(1,3-dioxaindan-5-yl)-4-oxobutyl]carbamate structure
|
Common Name | benzyl N-[4-(1,3-dioxaindan-5-yl)-4-oxobutyl]carbamate | ||
|---|---|---|---|---|
| CAS Number | 2680835-91-8 | Molecular Weight | 341.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H19NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | benzyl N-[4-(1,3-dioxaindan-5-yl)-4-oxobutyl]carbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H19NO5 |
|---|---|
| Molecular Weight | 341.4 |
| InChIKey | WEOOXRWJBWPSFC-UHFFFAOYSA-N |
| SMILES | O=C(NCCCC(=O)c1ccc2c(c1)OCO2)OCc1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of benzyl N-[4-(1,3-dioxaindan-5-yl)-4-oxobutyl]carbamate? |
| A: Molecular formula of benzyl N-[4-(1,3-dioxaindan-5-yl)-4-oxobutyl]carbamate is C19H19NO5. |
| Q: What is the molecular weight of benzyl N-[4-(1,3-dioxaindan-5-yl)-4-oxobutyl]carbamate? |
| A: Molecular weight of benzyl N-[4-(1,3-dioxaindan-5-yl)-4-oxobutyl]carbamate is 341.4. |
| Q: What is the InChIKey of benzyl N-[4-(1,3-dioxaindan-5-yl)-4-oxobutyl]carbamate? |
| A: InChIKey of benzyl N-[4-(1,3-dioxaindan-5-yl)-4-oxobutyl]carbamate is WEOOXRWJBWPSFC-UHFFFAOYSA-N. |
| Q: What is the English name of benzyl N-[4-(1,3-dioxaindan-5-yl)-4-oxobutyl]carbamate? |
| A: The English name of benzyl N-[4-(1,3-dioxaindan-5-yl)-4-oxobutyl]carbamate is benzyl N-[4-(1,3-dioxaindan-5-yl)-4-oxobutyl]carbamate. |
| Q: What is the SMILES notation of benzyl N-[4-(1,3-dioxaindan-5-yl)-4-oxobutyl]carbamate? |
| A: SMILES notation of benzyl N-[4-(1,3-dioxaindan-5-yl)-4-oxobutyl]carbamate is O=C(NCCCC(=O)c1ccc2c(c1)OCO2)OCc1ccccc1. |
| Q: What is the Chinese name of 2680835-91-8? |
| A: Chinese name of 2680835-91-8 is 2680835-91-8. |
| Q: What is the CAS number of benzyl N-[4-(1,3-dioxaindan-5-yl)-4-oxobutyl]carbamate? |
| A: CAS number of benzyl N-[4-(1,3-dioxaindan-5-yl)-4-oxobutyl]carbamate is 2680835-91-8. |