({5-[(tert-butoxy)carbonyl]-1-methyl-1H-imidazol-2-yl}methyl)carbamic acid
Modify Date: 2025-09-17 07:23:38
![({5-[(tert-butoxy)carbonyl]-1-methyl-1H-imidazol-2-yl}methyl)carbamic acid Structure](https://www.chemsrc.com/extcaspic/282/2680857-90-1.png)
({5-[(tert-butoxy)carbonyl]-1-methyl-1H-imidazol-2-yl}methyl)carbamic acid structure
|
Common Name | ({5-[(tert-butoxy)carbonyl]-1-methyl-1H-imidazol-2-yl}methyl)carbamic acid | ||
|---|---|---|---|---|
| CAS Number | 2680857-90-1 | Molecular Weight | 255.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H17N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ({5-[(tert-butoxy)carbonyl]-1-methyl-1H-imidazol-2-yl}methyl)carbamic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H17N3O4 |
|---|---|
| Molecular Weight | 255.27 |
| InChIKey | TXPCOQMAZYXGJP-UHFFFAOYSA-N |
| SMILES | Cn1c(C(=O)OC(C)(C)C)cnc1CNC(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of ({5-[(tert-butoxy)carbonyl]-1-methyl-1H-imidazol-2-yl}methyl)carbamic acid? |
| A: The English name of ({5-[(tert-butoxy)carbonyl]-1-methyl-1H-imidazol-2-yl}methyl)carbamic acid is ({5-[(tert-butoxy)carbonyl]-1-methyl-1H-imidazol-2-yl}methyl)carbamic acid. |
| Q: What is the Chinese name of 2680857-90-1? |
| A: Chinese name of 2680857-90-1 is 2680857-90-1. |
| Q: What is the InChIKey of ({5-[(tert-butoxy)carbonyl]-1-methyl-1H-imidazol-2-yl}methyl)carbamic acid? |
| A: InChIKey of ({5-[(tert-butoxy)carbonyl]-1-methyl-1H-imidazol-2-yl}methyl)carbamic acid is TXPCOQMAZYXGJP-UHFFFAOYSA-N. |
| Q: What is the CAS number of ({5-[(tert-butoxy)carbonyl]-1-methyl-1H-imidazol-2-yl}methyl)carbamic acid? |
| A: CAS number of ({5-[(tert-butoxy)carbonyl]-1-methyl-1H-imidazol-2-yl}methyl)carbamic acid is 2680857-90-1. |
| Q: What is the molecular weight of ({5-[(tert-butoxy)carbonyl]-1-methyl-1H-imidazol-2-yl}methyl)carbamic acid? |
| A: Molecular weight of ({5-[(tert-butoxy)carbonyl]-1-methyl-1H-imidazol-2-yl}methyl)carbamic acid is 255.27. |
| Q: What is the molecular formula of ({5-[(tert-butoxy)carbonyl]-1-methyl-1H-imidazol-2-yl}methyl)carbamic acid? |
| A: Molecular formula of ({5-[(tert-butoxy)carbonyl]-1-methyl-1H-imidazol-2-yl}methyl)carbamic acid is C11H17N3O4. |
| Q: What is the SMILES notation of ({5-[(tert-butoxy)carbonyl]-1-methyl-1H-imidazol-2-yl}methyl)carbamic acid? |
| A: SMILES notation of ({5-[(tert-butoxy)carbonyl]-1-methyl-1H-imidazol-2-yl}methyl)carbamic acid is Cn1c(C(=O)OC(C)(C)C)cnc1CNC(=O)O. |