benzyl N-methyl-N-[(4-nitrophenyl)methyl]carbamate
Modify Date: 2026-08-03 11:37:28
![benzyl N-methyl-N-[(4-nitrophenyl)methyl]carbamate Structure](https://www.chemsrc.com/extcaspic/335/2680871-66-1.png)
benzyl N-methyl-N-[(4-nitrophenyl)methyl]carbamate structure
|
Common Name | benzyl N-methyl-N-[(4-nitrophenyl)methyl]carbamate | ||
|---|---|---|---|---|
| CAS Number | 2680871-66-1 | Molecular Weight | 300.31 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H16N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | benzyl N-methyl-N-[(4-nitrophenyl)methyl]carbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H16N2O4 |
|---|---|
| Molecular Weight | 300.31 |
| InChIKey | AOTOORFINOQIBV-UHFFFAOYSA-N |
| SMILES | CN(Cc1ccc([N+](=O)[O-])cc1)C(=O)OCc1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of benzyl N-methyl-N-[(4-nitrophenyl)methyl]carbamate? |
| A: Molecular weight of benzyl N-methyl-N-[(4-nitrophenyl)methyl]carbamate is 300.31. |
| Q: What is the English name of benzyl N-methyl-N-[(4-nitrophenyl)methyl]carbamate? |
| A: The English name of benzyl N-methyl-N-[(4-nitrophenyl)methyl]carbamate is benzyl N-methyl-N-[(4-nitrophenyl)methyl]carbamate. |
| Q: What is the InChIKey of benzyl N-methyl-N-[(4-nitrophenyl)methyl]carbamate? |
| A: InChIKey of benzyl N-methyl-N-[(4-nitrophenyl)methyl]carbamate is AOTOORFINOQIBV-UHFFFAOYSA-N. |
| Q: What is the CAS number of benzyl N-methyl-N-[(4-nitrophenyl)methyl]carbamate? |
| A: CAS number of benzyl N-methyl-N-[(4-nitrophenyl)methyl]carbamate is 2680871-66-1. |
| Q: What is the SMILES notation of benzyl N-methyl-N-[(4-nitrophenyl)methyl]carbamate? |
| A: SMILES notation of benzyl N-methyl-N-[(4-nitrophenyl)methyl]carbamate is CN(Cc1ccc([N+](=O)[O-])cc1)C(=O)OCc1ccccc1. |
| Q: What is the molecular formula of benzyl N-methyl-N-[(4-nitrophenyl)methyl]carbamate? |
| A: Molecular formula of benzyl N-methyl-N-[(4-nitrophenyl)methyl]carbamate is C16H16N2O4. |
| Q: What is the Chinese name of 2680871-66-1? |
| A: Chinese name of 2680871-66-1 is 2680871-66-1. |