tert-butyl N-(3,5,6-trichloropyridin-2-yl)carbamate
Modify Date: 2026-07-08 13:57:01
tert-butyl N-(3,5,6-trichloropyridin-2-yl)carbamate structure
|
Common Name | tert-butyl N-(3,5,6-trichloropyridin-2-yl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 2680875-07-2 | Molecular Weight | 297.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H11Cl3N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | tert-butyl N-(3,5,6-trichloropyridin-2-yl)carbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H11Cl3N2O2 |
|---|---|
| Molecular Weight | 297.6 |
| InChIKey | HDYBNEGJTMRLLQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)Nc1nc(Cl)c(Cl)cc1Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of tert-butyl N-(3,5,6-trichloropyridin-2-yl)carbamate? |
| A: Molecular weight of tert-butyl N-(3,5,6-trichloropyridin-2-yl)carbamate is 297.6. |
| Q: What is the Chinese name of 2680875-07-2? |
| A: Chinese name of 2680875-07-2 is 2680875-07-2. |
| Q: What is the InChIKey of tert-butyl N-(3,5,6-trichloropyridin-2-yl)carbamate? |
| A: InChIKey of tert-butyl N-(3,5,6-trichloropyridin-2-yl)carbamate is HDYBNEGJTMRLLQ-UHFFFAOYSA-N. |
| Q: What is the English name of tert-butyl N-(3,5,6-trichloropyridin-2-yl)carbamate? |
| A: The English name of tert-butyl N-(3,5,6-trichloropyridin-2-yl)carbamate is tert-butyl N-(3,5,6-trichloropyridin-2-yl)carbamate. |
| Q: What is the CAS number of tert-butyl N-(3,5,6-trichloropyridin-2-yl)carbamate? |
| A: CAS number of tert-butyl N-(3,5,6-trichloropyridin-2-yl)carbamate is 2680875-07-2. |
| Q: What is the molecular formula of tert-butyl N-(3,5,6-trichloropyridin-2-yl)carbamate? |
| A: Molecular formula of tert-butyl N-(3,5,6-trichloropyridin-2-yl)carbamate is C10H11Cl3N2O2. |
| Q: What is the SMILES notation of tert-butyl N-(3,5,6-trichloropyridin-2-yl)carbamate? |
| A: SMILES notation of tert-butyl N-(3,5,6-trichloropyridin-2-yl)carbamate is CC(C)(C)OC(=O)Nc1nc(Cl)c(Cl)cc1Cl. |