benzyl N-[5-(2-chloroethyl)-8-thia-4,6-diazatricyclo[7.4.0.0,2,7]trideca-1(9),2,4,6-tetraen-3-yl]carbamate structure
|
Common Name | benzyl N-[5-(2-chloroethyl)-8-thia-4,6-diazatricyclo[7.4.0.0,2,7]trideca-1(9),2,4,6-tetraen-3-yl]carbamate | ||
|---|---|---|---|---|
| CAS Number | 2680875-48-1 | Molecular Weight | 401.9 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H20ClN3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | benzyl N-[5-(2-chloroethyl)-8-thia-4,6-diazatricyclo[7.4.0.0,2,7]trideca-1(9),2,4,6-tetraen-3-yl]carbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H20ClN3O2S |
|---|---|
| Molecular Weight | 401.9 |
| InChIKey | FEWAUEVIKKMRFW-UHFFFAOYSA-N |
| SMILES | O=C(Nc1nc(CCCl)nc2sc3c(c12)CCCC3)OCc1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of benzyl N-[5-(2-chloroethyl)-8-thia-4,6-diazatricyclo[7.4.0.0,2,7]trideca-1(9),2,4,6-tetraen-3-yl]carbamate? |
| A: Molecular weight of benzyl N-[5-(2-chloroethyl)-8-thia-4,6-diazatricyclo[7.4.0.0,2,7]trideca-1(9),2,4,6-tetraen-3-yl]carbamate is 401.9. |
| Q: What is the English name of benzyl N-[5-(2-chloroethyl)-8-thia-4,6-diazatricyclo[7.4.0.0,2,7]trideca-1(9),2,4,6-tetraen-3-yl]carbamate? |
| A: The English name of benzyl N-[5-(2-chloroethyl)-8-thia-4,6-diazatricyclo[7.4.0.0,2,7]trideca-1(9),2,4,6-tetraen-3-yl]carbamate is benzyl N-[5-(2-chloroethyl)-8-thia-4,6-diazatricyclo[7.4.0.0,2,7]trideca-1(9),2,4,6-tetraen-3-yl]carbamate. |
| Q: What is the InChIKey of benzyl N-[5-(2-chloroethyl)-8-thia-4,6-diazatricyclo[7.4.0.0,2,7]trideca-1(9),2,4,6-tetraen-3-yl]carbamate? |
| A: InChIKey of benzyl N-[5-(2-chloroethyl)-8-thia-4,6-diazatricyclo[7.4.0.0,2,7]trideca-1(9),2,4,6-tetraen-3-yl]carbamate is FEWAUEVIKKMRFW-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of benzyl N-[5-(2-chloroethyl)-8-thia-4,6-diazatricyclo[7.4.0.0,2,7]trideca-1(9),2,4,6-tetraen-3-yl]carbamate? |
| A: SMILES notation of benzyl N-[5-(2-chloroethyl)-8-thia-4,6-diazatricyclo[7.4.0.0,2,7]trideca-1(9),2,4,6-tetraen-3-yl]carbamate is O=C(Nc1nc(CCCl)nc2sc3c(c12)CCCC3)OCc1ccccc1. |
| Q: What is the molecular formula of benzyl N-[5-(2-chloroethyl)-8-thia-4,6-diazatricyclo[7.4.0.0,2,7]trideca-1(9),2,4,6-tetraen-3-yl]carbamate? |
| A: Molecular formula of benzyl N-[5-(2-chloroethyl)-8-thia-4,6-diazatricyclo[7.4.0.0,2,7]trideca-1(9),2,4,6-tetraen-3-yl]carbamate is C20H20ClN3O2S. |
| Q: What is the CAS number of benzyl N-[5-(2-chloroethyl)-8-thia-4,6-diazatricyclo[7.4.0.0,2,7]trideca-1(9),2,4,6-tetraen-3-yl]carbamate? |
| A: CAS number of benzyl N-[5-(2-chloroethyl)-8-thia-4,6-diazatricyclo[7.4.0.0,2,7]trideca-1(9),2,4,6-tetraen-3-yl]carbamate is 2680875-48-1. |
| Q: What is the Chinese name of 2680875-48-1? |
| A: Chinese name of 2680875-48-1 is 2680875-48-1. |