2-{[(Tert-butoxy)carbonyl](2-methoxyethyl)amino}-5-nitrobenzoic acid
Modify Date: 2025-12-26 19:53:34
amino}-5-nitrobenzoic acid Structure](https://www.chemsrc.com/extcaspic/120/2680875-79-8.png)
2-{[(Tert-butoxy)carbonyl](2-methoxyethyl)amino}-5-nitrobenzoic acid structure
|
Common Name | 2-{[(Tert-butoxy)carbonyl](2-methoxyethyl)amino}-5-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 2680875-79-8 | Molecular Weight | 340.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H20N2O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-{[(Tert-butoxy)carbonyl](2-methoxyethyl)amino}-5-nitrobenzoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H20N2O7 |
|---|---|
| Molecular Weight | 340.33 |
| InChIKey | WVONJJOXNGWOHC-UHFFFAOYSA-N |
| SMILES | COCCN(C(=O)OC(C)(C)C)c1ccc([N+](=O)[O-])cc1C(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 2-{[(Tert-butoxy)carbonyl](2-methoxyethyl)amino}-5-nitrobenzoic acid? |
| A: Molecular weight of 2-{[(Tert-butoxy)carbonyl](2-methoxyethyl)amino}-5-nitrobenzoic acid is 340.33. |
| Q: What is the CAS number of 2-{[(Tert-butoxy)carbonyl](2-methoxyethyl)amino}-5-nitrobenzoic acid? |
| A: CAS number of 2-{[(Tert-butoxy)carbonyl](2-methoxyethyl)amino}-5-nitrobenzoic acid is 2680875-79-8. |
| Q: What is the Chinese name of 2680875-79-8? |
| A: Chinese name of 2680875-79-8 is 2680875-79-8. |
| Q: What is the SMILES notation of 2-{[(Tert-butoxy)carbonyl](2-methoxyethyl)amino}-5-nitrobenzoic acid? |
| A: SMILES notation of 2-{[(Tert-butoxy)carbonyl](2-methoxyethyl)amino}-5-nitrobenzoic acid is COCCN(C(=O)OC(C)(C)C)c1ccc([N+](=O)[O-])cc1C(=O)O. |
| Q: What is the molecular formula of 2-{[(Tert-butoxy)carbonyl](2-methoxyethyl)amino}-5-nitrobenzoic acid? |
| A: Molecular formula of 2-{[(Tert-butoxy)carbonyl](2-methoxyethyl)amino}-5-nitrobenzoic acid is C15H20N2O7. |
| Q: What is the InChIKey of 2-{[(Tert-butoxy)carbonyl](2-methoxyethyl)amino}-5-nitrobenzoic acid? |
| A: InChIKey of 2-{[(Tert-butoxy)carbonyl](2-methoxyethyl)amino}-5-nitrobenzoic acid is WVONJJOXNGWOHC-UHFFFAOYSA-N. |
| Q: What is the English name of 2-{[(Tert-butoxy)carbonyl](2-methoxyethyl)amino}-5-nitrobenzoic acid? |
| A: The English name of 2-{[(Tert-butoxy)carbonyl](2-methoxyethyl)amino}-5-nitrobenzoic acid is 2-{[(Tert-butoxy)carbonyl](2-methoxyethyl)amino}-5-nitrobenzoic acid. |