Benzyl 3-[5-(hydroxymethyl)-1,3,4-thiadiazol-2-yl]azetidine-1-carboxylate
Modify Date: 2025-09-22 17:55:42
![Benzyl 3-[5-(hydroxymethyl)-1,3,4-thiadiazol-2-yl]azetidine-1-carboxylate Structure](https://www.chemsrc.com/extcaspic/461/2680879-24-5.png)
Benzyl 3-[5-(hydroxymethyl)-1,3,4-thiadiazol-2-yl]azetidine-1-carboxylate structure
|
Common Name | Benzyl 3-[5-(hydroxymethyl)-1,3,4-thiadiazol-2-yl]azetidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 2680879-24-5 | Molecular Weight | 305.35 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H15N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Benzyl 3-[5-(hydroxymethyl)-1,3,4-thiadiazol-2-yl]azetidine-1-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H15N3O3S |
|---|---|
| Molecular Weight | 305.35 |
| InChIKey | HZDLWQKVRRIJCE-UHFFFAOYSA-N |
| SMILES | O=C(OCc1ccccc1)N1CC(c2nnc(CO)s2)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Benzyl 3-[5-(hydroxymethyl)-1,3,4-thiadiazol-2-yl]azetidine-1-carboxylate? |
| A: The English name of Benzyl 3-[5-(hydroxymethyl)-1,3,4-thiadiazol-2-yl]azetidine-1-carboxylate is Benzyl 3-[5-(hydroxymethyl)-1,3,4-thiadiazol-2-yl]azetidine-1-carboxylate. |
| Q: What is the InChIKey of Benzyl 3-[5-(hydroxymethyl)-1,3,4-thiadiazol-2-yl]azetidine-1-carboxylate? |
| A: InChIKey of Benzyl 3-[5-(hydroxymethyl)-1,3,4-thiadiazol-2-yl]azetidine-1-carboxylate is HZDLWQKVRRIJCE-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of Benzyl 3-[5-(hydroxymethyl)-1,3,4-thiadiazol-2-yl]azetidine-1-carboxylate? |
| A: SMILES notation of Benzyl 3-[5-(hydroxymethyl)-1,3,4-thiadiazol-2-yl]azetidine-1-carboxylate is O=C(OCc1ccccc1)N1CC(c2nnc(CO)s2)C1. |
| Q: What is the molecular weight of Benzyl 3-[5-(hydroxymethyl)-1,3,4-thiadiazol-2-yl]azetidine-1-carboxylate? |
| A: Molecular weight of Benzyl 3-[5-(hydroxymethyl)-1,3,4-thiadiazol-2-yl]azetidine-1-carboxylate is 305.35. |
| Q: What is the Chinese name of 2680879-24-5? |
| A: Chinese name of 2680879-24-5 is 2680879-24-5. |
| Q: What is the molecular formula of Benzyl 3-[5-(hydroxymethyl)-1,3,4-thiadiazol-2-yl]azetidine-1-carboxylate? |
| A: Molecular formula of Benzyl 3-[5-(hydroxymethyl)-1,3,4-thiadiazol-2-yl]azetidine-1-carboxylate is C14H15N3O3S. |
| Q: What is the CAS number of Benzyl 3-[5-(hydroxymethyl)-1,3,4-thiadiazol-2-yl]azetidine-1-carboxylate? |
| A: CAS number of Benzyl 3-[5-(hydroxymethyl)-1,3,4-thiadiazol-2-yl]azetidine-1-carboxylate is 2680879-24-5. |