benzyl N-[5-(4-bromo-2-chlorophenyl)-1,3,4-oxadiazol-2-yl]carbamate
Modify Date: 2025-08-29 18:35:15
![benzyl N-[5-(4-bromo-2-chlorophenyl)-1,3,4-oxadiazol-2-yl]carbamate Structure](https://www.chemsrc.com/extcaspic/378/2680879-75-6.png)
benzyl N-[5-(4-bromo-2-chlorophenyl)-1,3,4-oxadiazol-2-yl]carbamate structure
|
Common Name | benzyl N-[5-(4-bromo-2-chlorophenyl)-1,3,4-oxadiazol-2-yl]carbamate | ||
|---|---|---|---|---|
| CAS Number | 2680879-75-6 | Molecular Weight | 408.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H11BrClN3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | benzyl N-[5-(4-bromo-2-chlorophenyl)-1,3,4-oxadiazol-2-yl]carbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H11BrClN3O3 |
|---|---|
| Molecular Weight | 408.6 |
| InChIKey | YSYMHQLOQRUVAU-UHFFFAOYSA-N |
| SMILES | O=C(Nc1nnc(-c2ccc(Br)cc2Cl)o1)OCc1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of benzyl N-[5-(4-bromo-2-chlorophenyl)-1,3,4-oxadiazol-2-yl]carbamate? |
| A: InChIKey of benzyl N-[5-(4-bromo-2-chlorophenyl)-1,3,4-oxadiazol-2-yl]carbamate is YSYMHQLOQRUVAU-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2680879-75-6? |
| A: Chinese name of 2680879-75-6 is 2680879-75-6. |
| Q: What is the English name of benzyl N-[5-(4-bromo-2-chlorophenyl)-1,3,4-oxadiazol-2-yl]carbamate? |
| A: The English name of benzyl N-[5-(4-bromo-2-chlorophenyl)-1,3,4-oxadiazol-2-yl]carbamate is benzyl N-[5-(4-bromo-2-chlorophenyl)-1,3,4-oxadiazol-2-yl]carbamate. |
| Q: What is the molecular formula of benzyl N-[5-(4-bromo-2-chlorophenyl)-1,3,4-oxadiazol-2-yl]carbamate? |
| A: Molecular formula of benzyl N-[5-(4-bromo-2-chlorophenyl)-1,3,4-oxadiazol-2-yl]carbamate is C16H11BrClN3O3. |
| Q: What is the molecular weight of benzyl N-[5-(4-bromo-2-chlorophenyl)-1,3,4-oxadiazol-2-yl]carbamate? |
| A: Molecular weight of benzyl N-[5-(4-bromo-2-chlorophenyl)-1,3,4-oxadiazol-2-yl]carbamate is 408.6. |
| Q: What is the SMILES notation of benzyl N-[5-(4-bromo-2-chlorophenyl)-1,3,4-oxadiazol-2-yl]carbamate? |
| A: SMILES notation of benzyl N-[5-(4-bromo-2-chlorophenyl)-1,3,4-oxadiazol-2-yl]carbamate is O=C(Nc1nnc(-c2ccc(Br)cc2Cl)o1)OCc1ccccc1. |
| Q: What is the CAS number of benzyl N-[5-(4-bromo-2-chlorophenyl)-1,3,4-oxadiazol-2-yl]carbamate? |
| A: CAS number of benzyl N-[5-(4-bromo-2-chlorophenyl)-1,3,4-oxadiazol-2-yl]carbamate is 2680879-75-6. |