Ethyl 2-{[(tert-butoxy)carbonyl]amino}-3-iodo-5-(trifluoromethyl)benzoate
Modify Date: 2025-11-07 15:06:00
![Ethyl 2-{[(tert-butoxy)carbonyl]amino}-3-iodo-5-(trifluoromethyl)benzoate Structure](https://www.chemsrc.com/extcaspic/081/2680891-69-2.png)
Ethyl 2-{[(tert-butoxy)carbonyl]amino}-3-iodo-5-(trifluoromethyl)benzoate structure
|
Common Name | Ethyl 2-{[(tert-butoxy)carbonyl]amino}-3-iodo-5-(trifluoromethyl)benzoate | ||
|---|---|---|---|---|
| CAS Number | 2680891-69-2 | Molecular Weight | 459.20 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H17F3INO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Ethyl 2-{[(tert-butoxy)carbonyl]amino}-3-iodo-5-(trifluoromethyl)benzoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H17F3INO4 |
|---|---|
| Molecular Weight | 459.20 |
| InChIKey | SBLLNCXQOYDYPP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc(C(F)(F)F)cc(I)c1NC(=O)OC(C)(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Ethyl 2-{[(tert-butoxy)carbonyl]amino}-3-iodo-5-(trifluoromethyl)benzoate? |
| A: CAS number of Ethyl 2-{[(tert-butoxy)carbonyl]amino}-3-iodo-5-(trifluoromethyl)benzoate is 2680891-69-2. |
| Q: What is the molecular formula of Ethyl 2-{[(tert-butoxy)carbonyl]amino}-3-iodo-5-(trifluoromethyl)benzoate? |
| A: Molecular formula of Ethyl 2-{[(tert-butoxy)carbonyl]amino}-3-iodo-5-(trifluoromethyl)benzoate is C15H17F3INO4. |
| Q: What is the molecular weight of Ethyl 2-{[(tert-butoxy)carbonyl]amino}-3-iodo-5-(trifluoromethyl)benzoate? |
| A: Molecular weight of Ethyl 2-{[(tert-butoxy)carbonyl]amino}-3-iodo-5-(trifluoromethyl)benzoate is 459.20. |
| Q: What is the Chinese name of 2680891-69-2? |
| A: Chinese name of 2680891-69-2 is 2680891-69-2. |
| Q: What is the SMILES notation of Ethyl 2-{[(tert-butoxy)carbonyl]amino}-3-iodo-5-(trifluoromethyl)benzoate? |
| A: SMILES notation of Ethyl 2-{[(tert-butoxy)carbonyl]amino}-3-iodo-5-(trifluoromethyl)benzoate is CCOC(=O)c1cc(C(F)(F)F)cc(I)c1NC(=O)OC(C)(C)C. |
| Q: What is the InChIKey of Ethyl 2-{[(tert-butoxy)carbonyl]amino}-3-iodo-5-(trifluoromethyl)benzoate? |
| A: InChIKey of Ethyl 2-{[(tert-butoxy)carbonyl]amino}-3-iodo-5-(trifluoromethyl)benzoate is SBLLNCXQOYDYPP-UHFFFAOYSA-N. |
| Q: What is the English name of Ethyl 2-{[(tert-butoxy)carbonyl]amino}-3-iodo-5-(trifluoromethyl)benzoate? |
| A: The English name of Ethyl 2-{[(tert-butoxy)carbonyl]amino}-3-iodo-5-(trifluoromethyl)benzoate is Ethyl 2-{[(tert-butoxy)carbonyl]amino}-3-iodo-5-(trifluoromethyl)benzoate. |