3-(2-Bromophenyl)-2-methyl-2-{[(prop-2-en-1-yloxy)carbonyl]amino}propanoic acid
Modify Date: 2025-09-17 10:35:43
![3-(2-Bromophenyl)-2-methyl-2-{[(prop-2-en-1-yloxy)carbonyl]amino}propanoic acid Structure](https://www.chemsrc.com/extcaspic/371/2680894-29-3.png)
3-(2-Bromophenyl)-2-methyl-2-{[(prop-2-en-1-yloxy)carbonyl]amino}propanoic acid structure
|
Common Name | 3-(2-Bromophenyl)-2-methyl-2-{[(prop-2-en-1-yloxy)carbonyl]amino}propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 2680894-29-3 | Molecular Weight | 342.18 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H16BrNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(2-Bromophenyl)-2-methyl-2-{[(prop-2-en-1-yloxy)carbonyl]amino}propanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H16BrNO4 |
|---|---|
| Molecular Weight | 342.18 |
| InChIKey | QLQQPSBRWNKNTM-UHFFFAOYSA-N |
| SMILES | C=CCOC(=O)NC(C)(Cc1ccccc1Br)C(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2680894-29-3? |
| A: Chinese name of 2680894-29-3 is 2680894-29-3. |
| Q: What is the SMILES notation of 3-(2-Bromophenyl)-2-methyl-2-{[(prop-2-en-1-yloxy)carbonyl]amino}propanoic acid? |
| A: SMILES notation of 3-(2-Bromophenyl)-2-methyl-2-{[(prop-2-en-1-yloxy)carbonyl]amino}propanoic acid is C=CCOC(=O)NC(C)(Cc1ccccc1Br)C(=O)O. |
| Q: What is the molecular weight of 3-(2-Bromophenyl)-2-methyl-2-{[(prop-2-en-1-yloxy)carbonyl]amino}propanoic acid? |
| A: Molecular weight of 3-(2-Bromophenyl)-2-methyl-2-{[(prop-2-en-1-yloxy)carbonyl]amino}propanoic acid is 342.18. |
| Q: What is the molecular formula of 3-(2-Bromophenyl)-2-methyl-2-{[(prop-2-en-1-yloxy)carbonyl]amino}propanoic acid? |
| A: Molecular formula of 3-(2-Bromophenyl)-2-methyl-2-{[(prop-2-en-1-yloxy)carbonyl]amino}propanoic acid is C14H16BrNO4. |
| Q: What is the InChIKey of 3-(2-Bromophenyl)-2-methyl-2-{[(prop-2-en-1-yloxy)carbonyl]amino}propanoic acid? |
| A: InChIKey of 3-(2-Bromophenyl)-2-methyl-2-{[(prop-2-en-1-yloxy)carbonyl]amino}propanoic acid is QLQQPSBRWNKNTM-UHFFFAOYSA-N. |
| Q: What is the CAS number of 3-(2-Bromophenyl)-2-methyl-2-{[(prop-2-en-1-yloxy)carbonyl]amino}propanoic acid? |
| A: CAS number of 3-(2-Bromophenyl)-2-methyl-2-{[(prop-2-en-1-yloxy)carbonyl]amino}propanoic acid is 2680894-29-3. |
| Q: What is the English name of 3-(2-Bromophenyl)-2-methyl-2-{[(prop-2-en-1-yloxy)carbonyl]amino}propanoic acid? |
| A: The English name of 3-(2-Bromophenyl)-2-methyl-2-{[(prop-2-en-1-yloxy)carbonyl]amino}propanoic acid is 3-(2-Bromophenyl)-2-methyl-2-{[(prop-2-en-1-yloxy)carbonyl]amino}propanoic acid. |