furan-2,5-dione,methyl 2-methylprop-2-enoate,styrene structure
|
Common Name | furan-2,5-dione,methyl 2-methylprop-2-enoate,styrene | ||
|---|---|---|---|---|
| CAS Number | 26809-51-8 | Molecular Weight | 302.32200 | |
| Density | N/A | Boiling Point | 145.2ºC at 760mmHg | |
| Molecular Formula | C17H18O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 31.1ºC | |
| Name | furan-2,5-dione,methyl 2-methylprop-2-enoate,styrene |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 145.2ºC at 760mmHg |
|---|---|
| Molecular Formula | C17H18O5 |
| Molecular Weight | 302.32200 |
| Flash Point | 31.1ºC |
| Exact Mass | 302.11500 |
| PSA | 69.67000 |
| LogP | 2.69110 |
| InChIKey | UMORIIZQJQHCBX-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)OC.C=Cc1ccccc1.O=C1C=CC(=O)O1 |
| 2-Propenoic acid,2-methyl-,methyl ester,polymer with ethenylbenzene and 2,5-furandione |
| Delpet 980 |