4-[2,2,2-trifluoro-N-(4-iodophenyl)acetamido]butanoic acid
Modify Date: 2025-10-20 08:26:15
![4-[2,2,2-trifluoro-N-(4-iodophenyl)acetamido]butanoic acid Structure](https://www.chemsrc.com/extcaspic/228/2680900-08-5.png)
4-[2,2,2-trifluoro-N-(4-iodophenyl)acetamido]butanoic acid structure
|
Common Name | 4-[2,2,2-trifluoro-N-(4-iodophenyl)acetamido]butanoic acid | ||
|---|---|---|---|---|
| CAS Number | 2680900-08-5 | Molecular Weight | 401.12 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H11F3INO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-[2,2,2-trifluoro-N-(4-iodophenyl)acetamido]butanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H11F3INO3 |
|---|---|
| Molecular Weight | 401.12 |
| InChIKey | IMYRVOPCCLOWSX-UHFFFAOYSA-N |
| SMILES | O=C(O)CCCN(C(=O)C(F)(F)F)c1ccc(I)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 4-[2,2,2-trifluoro-N-(4-iodophenyl)acetamido]butanoic acid? |
| A: Molecular weight of 4-[2,2,2-trifluoro-N-(4-iodophenyl)acetamido]butanoic acid is 401.12. |
| Q: What is the English name of 4-[2,2,2-trifluoro-N-(4-iodophenyl)acetamido]butanoic acid? |
| A: The English name of 4-[2,2,2-trifluoro-N-(4-iodophenyl)acetamido]butanoic acid is 4-[2,2,2-trifluoro-N-(4-iodophenyl)acetamido]butanoic acid. |
| Q: What is the InChIKey of 4-[2,2,2-trifluoro-N-(4-iodophenyl)acetamido]butanoic acid? |
| A: InChIKey of 4-[2,2,2-trifluoro-N-(4-iodophenyl)acetamido]butanoic acid is IMYRVOPCCLOWSX-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2680900-08-5? |
| A: Chinese name of 2680900-08-5 is 2680900-08-5. |
| Q: What is the CAS number of 4-[2,2,2-trifluoro-N-(4-iodophenyl)acetamido]butanoic acid? |
| A: CAS number of 4-[2,2,2-trifluoro-N-(4-iodophenyl)acetamido]butanoic acid is 2680900-08-5. |
| Q: What is the molecular formula of 4-[2,2,2-trifluoro-N-(4-iodophenyl)acetamido]butanoic acid? |
| A: Molecular formula of 4-[2,2,2-trifluoro-N-(4-iodophenyl)acetamido]butanoic acid is C12H11F3INO3. |
| Q: What is the SMILES notation of 4-[2,2,2-trifluoro-N-(4-iodophenyl)acetamido]butanoic acid? |
| A: SMILES notation of 4-[2,2,2-trifluoro-N-(4-iodophenyl)acetamido]butanoic acid is O=C(O)CCCN(C(=O)C(F)(F)F)c1ccc(I)cc1. |