(2E)-3-{2-[1-(2,2,2-trifluoroacetyl)azetidin-3-yl]phenyl}prop-2-enoic acid
Modify Date: 2026-04-08 00:13:45
![(2E)-3-{2-[1-(2,2,2-trifluoroacetyl)azetidin-3-yl]phenyl}prop-2-enoic acid Structure](https://www.chemsrc.com/extcaspic/094/2681256-40-4.png)
(2E)-3-{2-[1-(2,2,2-trifluoroacetyl)azetidin-3-yl]phenyl}prop-2-enoic acid structure
|
Common Name | (2E)-3-{2-[1-(2,2,2-trifluoroacetyl)azetidin-3-yl]phenyl}prop-2-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 2681256-40-4 | Molecular Weight | 299.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12F3NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2E)-3-{2-[1-(2,2,2-trifluoroacetyl)azetidin-3-yl]phenyl}prop-2-enoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H12F3NO3 |
|---|---|
| Molecular Weight | 299.24 |
| InChIKey | DACHMJZPONMVRF-AATRIKPKSA-N |
| SMILES | O=C(O)C=Cc1ccccc1C1CN(C(=O)C(F)(F)F)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of (2E)-3-{2-[1-(2,2,2-trifluoroacetyl)azetidin-3-yl]phenyl}prop-2-enoic acid? |
| A: CAS number of (2E)-3-{2-[1-(2,2,2-trifluoroacetyl)azetidin-3-yl]phenyl}prop-2-enoic acid is 2681256-40-4. |
| Q: What is the molecular weight of (2E)-3-{2-[1-(2,2,2-trifluoroacetyl)azetidin-3-yl]phenyl}prop-2-enoic acid? |
| A: Molecular weight of (2E)-3-{2-[1-(2,2,2-trifluoroacetyl)azetidin-3-yl]phenyl}prop-2-enoic acid is 299.24. |
| Q: What is the SMILES notation of (2E)-3-{2-[1-(2,2,2-trifluoroacetyl)azetidin-3-yl]phenyl}prop-2-enoic acid? |
| A: SMILES notation of (2E)-3-{2-[1-(2,2,2-trifluoroacetyl)azetidin-3-yl]phenyl}prop-2-enoic acid is O=C(O)C=Cc1ccccc1C1CN(C(=O)C(F)(F)F)C1. |
| Q: What is the InChIKey of (2E)-3-{2-[1-(2,2,2-trifluoroacetyl)azetidin-3-yl]phenyl}prop-2-enoic acid? |
| A: InChIKey of (2E)-3-{2-[1-(2,2,2-trifluoroacetyl)azetidin-3-yl]phenyl}prop-2-enoic acid is DACHMJZPONMVRF-AATRIKPKSA-N. |
| Q: What is the molecular formula of (2E)-3-{2-[1-(2,2,2-trifluoroacetyl)azetidin-3-yl]phenyl}prop-2-enoic acid? |
| A: Molecular formula of (2E)-3-{2-[1-(2,2,2-trifluoroacetyl)azetidin-3-yl]phenyl}prop-2-enoic acid is C14H12F3NO3. |
| Q: What is the Chinese name of 2681256-40-4? |
| A: Chinese name of 2681256-40-4 is 2681256-40-4. |
| Q: What is the English name of (2E)-3-{2-[1-(2,2,2-trifluoroacetyl)azetidin-3-yl]phenyl}prop-2-enoic acid? |
| A: The English name of (2E)-3-{2-[1-(2,2,2-trifluoroacetyl)azetidin-3-yl]phenyl}prop-2-enoic acid is (2E)-3-{2-[1-(2,2,2-trifluoroacetyl)azetidin-3-yl]phenyl}prop-2-enoic acid. |