4,7-Ethanoisobenzofuran-1,3-dione,hexahydro- structure
|
Common Name | 4,7-Ethanoisobenzofuran-1,3-dione,hexahydro- | ||
|---|---|---|---|---|
| CAS Number | 26843-47-0 | Molecular Weight | 180.20000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H12O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Bicyclo[2.2.2]octane-2,3-dicarboxylic anhydride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H12O3 |
|---|---|
| Molecular Weight | 180.20000 |
| Exact Mass | 180.07900 |
| PSA | 43.37000 |
| LogP | 1.12220 |
| Index of Refraction | 1.569 |
| InChIKey | BRHQMPOFCRGJCM-UHFFFAOYSA-N |
| SMILES | O=C1OC(=O)C2C3CCC(CC3)C12 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| bicyclo[2.2.2]octane-2,3-dicarboxylic acid anhydride |
| 4-oxa-tricyclo[5.2.2.02,6]undecane-3,5-dione |
| Bicyclo <2,2,2> octan-dicarbonsaeure-(2,3)-anhydrid |