dibenzo[a,h]phenazine-1,8-diol structure
|
Common Name | dibenzo[a,h]phenazine-1,8-diol | ||
|---|---|---|---|---|
| CAS Number | 26846-41-3 | Molecular Weight | 312.32100 | |
| Density | 1.44g/cm3 | Boiling Point | 649.9ºC at 760mmHg | |
| Molecular Formula | C20H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 346.9ºC | |
| Name | 8-hydroxydibenzo[a,h]phenazin-1(14h)-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.44g/cm3 |
|---|---|
| Boiling Point | 649.9ºC at 760mmHg |
| Molecular Formula | C20H12N2O2 |
| Molecular Weight | 312.32100 |
| Flash Point | 346.9ºC |
| Exact Mass | 312.09000 |
| PSA | 65.98000 |
| LogP | 4.08830 |
| Vapour Pressure | 1.71E-17mmHg at 25°C |
| Index of Refraction | 1.77 |
| InChIKey | RPRGEWDOVJZDPE-UHFFFAOYSA-N |
| SMILES | O=c1cccc2ccc3nc4c(ccc5cccc(O)c54)[nH]c3c12 |
| HS Code | 2933990090 |
|---|
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Dibenzo(a,h)phenazine-1,8-diol |
| EINECS 248-043-6 |
| Dibenzo[a,h]phenazin-1,8-diol |
| 1,8-dihydroxydibenzo[a,h]phenazine |