Imidazo[2,1-b]thiazol-3-ol,3-(4-chlorophenyl)-2-ethyl-2,3,5,6-tetrahydro- structure
|
Common Name | Imidazo[2,1-b]thiazol-3-ol,3-(4-chlorophenyl)-2-ethyl-2,3,5,6-tetrahydro- | ||
|---|---|---|---|---|
| CAS Number | 26847-34-7 | Molecular Weight | 282.78900 | |
| Density | 1.43g/cm3 | Boiling Point | 435.1ºC at 760mmHg | |
| Molecular Formula | C13H15ClN2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.9ºC | |
| Name | 3-(4-chlorophenyl)-2-ethyl-5,6-dihydro-2H-imidazo[2,1-b][1,3]thiazol-3-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.43g/cm3 |
|---|---|
| Boiling Point | 435.1ºC at 760mmHg |
| Molecular Formula | C13H15ClN2OS |
| Molecular Weight | 282.78900 |
| Flash Point | 216.9ºC |
| Exact Mass | 282.05900 |
| PSA | 61.13000 |
| LogP | 2.05560 |
| Vapour Pressure | 2.44E-08mmHg at 25°C |
| Index of Refraction | 1.689 |
| InChIKey | GHIYMSVUXQLJSA-UHFFFAOYSA-N |
| SMILES | CCC1SC2=NCCN2C1(O)c1ccc(Cl)cc1 |
| HS Code | 2934100090 |
|---|
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 3-(4-chloro-phenyl)-2-ethyl-2,3,5,6-tetrahydro-imidazo[2,1-b]thiazol-3-ol |
| 3-(p-chlorophenyl)-2-ethyl-2,3,5,6-tetrahydroimidazo[2,1-b]thiazol-3-ol |
| 3-(4-chlorophenyl)-2-ethyl-2H-2-imidazolino[2,1-b]1,3-thiazolidin-3-ol |
| 3-(p-Chlorphenyl)-2-ethyl-2,3,5,6-tetrahydroimidazo<2,1-b>thiazol-3-ol |
| Imidazo[2,1-b]thiazol-3-ol,3-(4-chlorophenyl)-2-ethyl-2,3,5,6-tetrahydro |