4-Phenanthrenecarboxylicacid, 9,10-dibromo-9,10-dihydro-, methyl ester structure
|
Common Name | 4-Phenanthrenecarboxylicacid, 9,10-dibromo-9,10-dihydro-, methyl ester | ||
|---|---|---|---|---|
| CAS Number | 26847-76-7 | Molecular Weight | 396.07300 | |
| Density | 1.702g/cm3 | Boiling Point | 452.1ºC at 760mmHg | |
| Molecular Formula | C16H12Br2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 227.2ºC | |
| Name | methyl 9,10-dibromo-9,10-dihydrophenanthrene-4-carboxylate |
|---|
| Density | 1.702g/cm3 |
|---|---|
| Boiling Point | 452.1ºC at 760mmHg |
| Molecular Formula | C16H12Br2O2 |
| Molecular Weight | 396.07300 |
| Flash Point | 227.2ºC |
| Exact Mass | 393.92000 |
| PSA | 26.30000 |
| LogP | 5.02580 |
| Vapour Pressure | 2.3E-08mmHg at 25°C |
| Index of Refraction | 1.658 |
| InChIKey | CLKBDWJCCYETQY-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cccc2c1-c1ccccc1C(Br)C2Br |
|
~%
4-Phenanthrenec... CAS#:26847-76-7 |
| Literature: Krbechek,L.O. et al. Journal of Medicinal Chemistry, 1970 , vol. 13, p. 234 - 238 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |