4'-Chloro-α-[(8-hydroxy-5-quinolyl)imino]acetophenone structure
|
Common Name | 4'-Chloro-α-[(8-hydroxy-5-quinolyl)imino]acetophenone | ||
|---|---|---|---|---|
| CAS Number | 26873-13-2 | Molecular Weight | 310.73400 | |
| Density | 1.32g/cm3 | Boiling Point | 556.5ºC at 760 mmHg | |
| Molecular Formula | C17H11ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 290.4ºC | |
| Name | 1-(4-chlorophenyl)-2-(8-hydroxyquinolin-5-yl)iminoethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 556.5ºC at 760 mmHg |
| Molecular Formula | C17H11ClN2O2 |
| Molecular Weight | 310.73400 |
| Flash Point | 290.4ºC |
| Exact Mass | 310.05100 |
| PSA | 62.55000 |
| LogP | 4.17900 |
| Vapour Pressure | 5.4E-13mmHg at 25°C |
| Index of Refraction | 1.652 |
| InChIKey | OWGBLARJUJOWNJ-UHFFFAOYSA-N |
| SMILES | O=C(C=Nc1ccc(O)c2ncccc12)c1ccc(Cl)cc1 |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 8-Quinolinol,5-((p-chlorophenyl)glyoxylidenamino) |
| 1-(4-chloro-phenyl)-2-(8-hydroxy-quinolin-5-ylimino)-ethanone |
| 5-((p-Chlorobenzoyl)methylenamino)-8-quinolinol |
| 8-Quinolinol,5-((p-chlorobenzoyl)methylenamino) |
| 5-((p-Chlorophenyl)glyoxylidenamino)-8-quinolinol |