α-[(8-Hydroxy-5-quinolyl)imino]-4'-(phenylthio)acetophenone structure
|
Common Name | α-[(8-Hydroxy-5-quinolyl)imino]-4'-(phenylthio)acetophenone | ||
|---|---|---|---|---|
| CAS Number | 26873-17-6 | Molecular Weight | 384.45000 | |
| Density | 1.25g/cm3 | Boiling Point | 651.6ºC at 760mmHg | |
| Molecular Formula | C23H16N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 347.9ºC | |
| Name | 2-(8-hydroxyquinolin-5-yl)imino-1-(4-phenylsulfanylphenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 651.6ºC at 760mmHg |
| Molecular Formula | C23H16N2O2S |
| Molecular Weight | 384.45000 |
| Flash Point | 347.9ºC |
| Exact Mass | 384.09300 |
| PSA | 87.85000 |
| LogP | 5.67680 |
| Vapour Pressure | 1.4E-17mmHg at 25°C |
| Index of Refraction | 1.664 |
| InChIKey | UHKAXXKXOHUTRG-UHFFFAOYSA-N |
| SMILES | O=C(C=Nc1ccc(O)c2ncccc12)c1ccc(Sc2ccccc2)cc1 |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (2e)-2-[(8-hydroxyquinolin-5-yl)imino]-1-[4-(phenylsulfanyl)phenyl]ethanone |
| 8-Quinolinol,5-((p-phenylthiophenyl)glyoxylidenamino) |
| 5-((p-Phenylthiobenzoyl)methylenamino)-8-quinolinol |
| 8-Quinolinol,5-((p-phenylthiobenzoyl)methylenamino) |
| 2-(8-hydroxy-quinolin-5-ylimino)-1-(4-phenylsulfanyl-phenyl)-ethanone |
| 5-((p-Phenylthiophenyl)glyoxylidenamino)-8-quinolinol |