4-Bromo-3,5-bis(trifluoromethyl)aniline structure
|
Common Name | 4-Bromo-3,5-bis(trifluoromethyl)aniline | ||
|---|---|---|---|---|
| CAS Number | 268733-18-2 | Molecular Weight | 308.01800 | |
| Density | 1.76g/cm3 | Boiling Point | 210.7ºC at 760 mmHg | |
| Molecular Formula | C8H4BrF6N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 81.2ºC | |
| Name | 4-bromo-3,5-bis(trifluoromethyl)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.76g/cm3 |
|---|---|
| Boiling Point | 210.7ºC at 760 mmHg |
| Molecular Formula | C8H4BrF6N |
| Molecular Weight | 308.01800 |
| Flash Point | 81.2ºC |
| Exact Mass | 306.94300 |
| PSA | 26.02000 |
| LogP | 4.65010 |
| Vapour Pressure | 0.19mmHg at 25°C |
| Index of Refraction | 1.462 |
| InChIKey | ZMVAVUAHKPGYTF-UHFFFAOYSA-N |
| SMILES | Nc1cc(C(F)(F)F)c(Br)c(C(F)(F)F)c1 |
| HS Code | 2921420090 |
|---|
| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| CK1173 |
| 4-bromo-3,5-bis-(trifluoromethyl)aniline |
| 4-bromo-3,5-bis(trifluoromethyl)benzenamine |