Gluconate-1-13C sodium structure
|
Common Name | Gluconate-1-13C sodium | ||
|---|---|---|---|---|
| CAS Number | 2687959-99-3 | Molecular Weight | 219.13 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C513CH11NaO7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Gluconate-1-13C sodiumGluconate-1-13C sodium is the 13C labeled Gluconate sodi[1][2]. |
| Name | Gluconate-1-13C sodium |
|---|
| Description | Gluconate-1-13C sodium is the 13C labeled Gluconate sodi[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C513CH11NaO7 |
|---|---|
| Molecular Weight | 219.13 |
| InChIKey | UPMFZISCCZSDND-RYHRKSQGSA-M |
| SMILES | O=C([O-])C(O)C(O)C(O)C(O)CO.[Na+] |