Benzenamine,N,N-diethyl-4-[2-(1H-1,2,4-triazol-5-yl)diazenyl]- structure
|
Common Name | Benzenamine,N,N-diethyl-4-[2-(1H-1,2,4-triazol-5-yl)diazenyl]- | ||
|---|---|---|---|---|
| CAS Number | 26903-94-6 | Molecular Weight | 244.29600 | |
| Density | 1.21g/cm3 | Boiling Point | 366ºC at 760mmHg | |
| Molecular Formula | C12H16N6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.2ºC | |
| Name | 3-[[(4'-N,N-Diethylamino)phenyl]azo]-1H-1,2,4-triazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 366ºC at 760mmHg |
| Molecular Formula | C12H16N6 |
| Molecular Weight | 244.29600 |
| Flash Point | 175.2ºC |
| Exact Mass | 244.14400 |
| PSA | 69.53000 |
| LogP | 3.06630 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.629 |
| InChIKey | KTKFBJWQVDOLMK-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1ccc(N=Nc2ncn[nH]2)cc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-p-Diethylaminophenylazo-1,2,4-triazol |
| 5-[4-(Diethylamino)phenylazo]-1H-1,2,4-triazole |
| N,N-diethyl-4-(1H-[1,2,4]triazol-3-ylazo)-aniline |