Ac-Ala-Ala-Ala-OMe structure
|
Common Name | Ac-Ala-Ala-Ala-OMe | ||
|---|---|---|---|---|
| CAS Number | 26910-17-8 | Molecular Weight | 287.31200 | |
| Density | 1.153g/cm3 | Boiling Point | 582.7ºC at 760mmHg | |
| Molecular Formula | C12H21N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 306.2ºC | |
| Name | Ac-Ala-Ala-Ala-OMe |
|---|---|
| Synonym | More Synonyms |
| Density | 1.153g/cm3 |
|---|---|
| Boiling Point | 582.7ºC at 760mmHg |
| Molecular Formula | C12H21N3O5 |
| Molecular Weight | 287.31200 |
| Flash Point | 306.2ºC |
| Exact Mass | 287.14800 |
| PSA | 113.60000 |
| Vapour Pressure | 1.44E-13mmHg at 25°C |
| Index of Refraction | 1.475 |
| InChIKey | FKSWBCPVKXRWMC-FXQIFTODSA-N |
| SMILES | COC(=O)C(C)NC(=O)C(C)NC(=O)C(C)NC(C)=O |
| HS Code | 2924199090 |
|---|
|
~%
Ac-Ala-Ala-Ala-OMe CAS#:26910-17-8 |
| Literature: Jahreis, Guenther; Fittkau, Siegfried Journal fuer Praktische Chemie (Leipzig), 1984 , vol. 326, # 1 p. 35 - 40 |
|
~%
Ac-Ala-Ala-Ala-OMe CAS#:26910-17-8 |
| Literature: Jahreis, Guenther; Fittkau, Siegfried Journal fuer Praktische Chemie (Leipzig), 1984 , vol. 326, # 1 p. 35 - 40 |
|
~84%
Ac-Ala-Ala-Ala-OMe CAS#:26910-17-8 |
| Literature: Jahreis, Guenther; Fittkau, Siegfried Journal fuer Praktische Chemie (Leipzig), 1984 , vol. 326, # 1 p. 35 - 40 |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-ACETYL-ALA-ALA-ALA METHYL ESTER |
| Ac-Ala3-OMe |
| Ac-L-Ala-L-Ala-L-Ala-OMe |
| N-Ac-L-Ala-L-Ala-L-Ala-OMe |
| methyl-N-acetyl-N-L-alanyl-N-L-alanyl alaninate |
| N-acetyl(L-Ala)3OCH3 |
| N-acetyltri-L-alanyl methyl ester |
| N-acetyl-L-alanyl-L-alanyl-L-alanine methyl ester |
| N-acetyltrialanine methyl ester |