2-hydroxyethyl 2-methylprop-2-enoate,2-methylidenehexanoic acid,styrene structure
|
Common Name | 2-hydroxyethyl 2-methylprop-2-enoate,2-methylidenehexanoic acid,styrene | ||
|---|---|---|---|---|
| CAS Number | 26916-03-0 | Molecular Weight | 362.46000 | |
| Density | N/A | Boiling Point | 221.9ºC at 760mmHg | |
| Molecular Formula | C21H30O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 128.6ºC | |
| Name | 2-hydroxyethyl 2-methylprop-2-enoate,2-methylidenehexanoic acid,styrene |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 221.9ºC at 760mmHg |
|---|---|
| Molecular Formula | C21H30O5 |
| Molecular Weight | 362.46000 |
| Flash Point | 128.6ºC |
| Exact Mass | 362.20900 |
| PSA | 83.83000 |
| LogP | 4.24500 |
| InChIKey | HKOZANRCYRXCAQ-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)OCCO.C=C(CCCC)C(=O)O.C=Cc1ccccc1 |
| Styrene,butyl acrylate,2-hydroxyethyl methacrylate polymer |
| 2-Propenoic acid,2-methyl-,2-hydroxyethyl ester,polymer with butyl 2-propenoate and ethenylbenzene |