(3,5-Dimethyladamantan-1-yl)methanol structure
|
Common Name | (3,5-Dimethyladamantan-1-yl)methanol | ||
|---|---|---|---|---|
| CAS Number | 26919-42-6 | Molecular Weight | 194.313 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 265.8±8.0 °C at 760 mmHg | |
| Molecular Formula | C13H22O | Melting Point | 58-62ºC | |
| MSDS | Chinese USA | Flash Point | 121.4±8.6 °C | |
| Name | (3,5-dimethyl-1-adamantyl)methanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 265.8±8.0 °C at 760 mmHg |
| Melting Point | 58-62ºC |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.313 |
| Flash Point | 121.4±8.6 °C |
| Exact Mass | 194.167068 |
| PSA | 20.23000 |
| LogP | 3.65 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.544 |
| InChIKey | RVWLWJAOIBEWAV-UHFFFAOYSA-N |
| SMILES | CC12CC3CC(C)(C1)CC(CO)(C3)C2 |
| RIDADR | NONH for all modes of transport |
|---|---|
| HS Code | 2906199090 |
| Precursor 6 | |
|---|---|
| DownStream 3 | |
| HS Code | 2906199090 |
|---|---|
| Summary | 2906199090. cyclanic, cyclenic or cyclotherpenic alcohols. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| [(1r,3R,5S,7r)-3,5-Dimethyladamantan-1-yl]methanol |
| (3,5-dimethyladamantanyl)methan-1-ol |
| 3,5-Dimethyl-1-hydroxymethyl-adamantan |
| 3,5-Dimethyl-1-adamantanemethanol |
| Tricyclo[3.3.1.1]decane-1-methanol, 3,5-dimethyl-, (3R,5S)- |
| (3,5-dimethyladamant-1-yl)methanol |
| 3,5-Dimethyl-1-(hydroxymethyl)adamantane |
| 3,5-Dimethyl-1-(hydroxymethyl)adamantane,3,5-Dimethyltricyclo[3.3.1.13,7]decane-1-methanol |
| (3,5-Dimethyladamantan-1-yl)methanol |
| 3,5-Dimethyladamantane-1-methanol |
| F3095-4894 |
| MFCD00188062 |
| Tricyclo[3.3.1.1]decane-1-methanol, 3,5-dimethyl- |
| 3,5-Dimethyltricyclo[3.3.1.13,7]decane-1-methanol |