Boc-(R)-3-Amino-4-(4-iodophenyl)-butyric acid structure
|
Common Name | Boc-(R)-3-Amino-4-(4-iodophenyl)-butyric acid | ||
|---|---|---|---|---|
| CAS Number | 269396-71-6 | Molecular Weight | 405.22800 | |
| Density | 1.516g/cm3 | Boiling Point | 492.2ºC at 760mmHg | |
| Molecular Formula | C15H20INO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 251.5ºC | |
| Name | Boc-(R)-3-amino-4-(4-iodophenyl)-butyric acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.516g/cm3 |
|---|---|
| Boiling Point | 492.2ºC at 760mmHg |
| Molecular Formula | C15H20INO4 |
| Molecular Weight | 405.22800 |
| Flash Point | 251.5ºC |
| Exact Mass | 405.04400 |
| PSA | 75.63000 |
| LogP | 3.59260 |
| Vapour Pressure | 1.67E-10mmHg at 25°C |
| Index of Refraction | 1.572 |
| InChIKey | QEKSTALXWONXOD-GFCCVEGCSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC(=O)O)Cc1ccc(I)cc1 |
|
~%
Boc-(R)-3-Amino... CAS#:269396-71-6 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 14, # 18 p. 4759 - 4762 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| MFCD01860963 |
| (R)-3-(Boc-amino)-4-(4-iodophenyl)butyric acid |
| BOC-(R)-3-AMINO-4-(4-IODO-PHENYL)-BUTYRIC ACID |