Boc-(R)-3-amino-4-(2-trifluoromethylphenyl)-butyric acid
Boc-(R)-3-amino-4-(2-trifluoromethylphenyl)-butyric acid structure
|
Common Name | Boc-(R)-3-amino-4-(2-trifluoromethylphenyl)-butyric acid | ||
|---|---|---|---|---|
| CAS Number | 269396-77-2 | Molecular Weight | 347.329 | |
| Density | 1.246 | Boiling Point | 436.9±45.0 °C at 760 mmHg | |
| Molecular Formula | C16H20F3NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218.0±28.7 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Boc-(R)-3-amino-4-(2-trifluoromethylphenyl)-butyric acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.246 |
|---|---|
| Boiling Point | 436.9±45.0 °C at 760 mmHg |
| Molecular Formula | C16H20F3NO4 |
| Molecular Weight | 347.329 |
| Flash Point | 218.0±28.7 °C |
| Exact Mass | 347.134430 |
| PSA | 75.63000 |
| LogP | 3.61 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.495 |
| InChIKey | YQJFIZXCXGBMPB-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC(=O)O)Cc1ccccc1C(F)(F)F |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2924299090 |
|---|
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| (3R)-3-Amino-5-[(2-methyl-2-propanyl)oxy]-5-oxo-4-[2-(trifluoromethyl)phenyl]pentanoic acid |
| (3R)-3-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-4-[2-(trifluoromethyl)phenyl]butanoic acid |
| boc-(r)-3-amino-4-(2-trifluoromethyl-phenyl)-butyric acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does Boc-(R)-3-amino-4-(2-trifluoromethylphenyl)-butyric acid have? |
| A: English synonyms of Boc-(R)-3-amino-4-(2-trifluoromethylphenyl)-butyric acid: (3R)-3-Amino-5-[(2-methyl-2-propanyl)oxy]-5-oxo-4-[2-(trifluoromethyl)phenyl]pentanoic acid, (3R)-3-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-4-[2-(trifluoromethyl)phenyl]butanoic acid, boc-(r)-3-amino-4-(2-trifluoromethyl-phenyl)-butyric acid. |
| Q: What is the CAS number of Boc-(R)-3-amino-4-(2-trifluoromethylphenyl)-butyric acid? |
| A: CAS number of Boc-(R)-3-amino-4-(2-trifluoromethylphenyl)-butyric acid is 269396-77-2. |
| Q: What is the SMILES notation of Boc-(R)-3-amino-4-(2-trifluoromethylphenyl)-butyric acid? |
| A: SMILES notation of Boc-(R)-3-amino-4-(2-trifluoromethylphenyl)-butyric acid is CC(C)(C)OC(=O)NC(CC(=O)O)Cc1ccccc1C(F)(F)F. |
| Q: What is the LogP of Boc-(R)-3-amino-4-(2-trifluoromethylphenyl)-butyric acid? |
| A: LogP of Boc-(R)-3-amino-4-(2-trifluoromethylphenyl)-butyric acid is 3.61. |
| Q: What is the boiling point of Boc-(R)-3-amino-4-(2-trifluoromethylphenyl)-butyric acid? |
| A: Boiling point of Boc-(R)-3-amino-4-(2-trifluoromethylphenyl)-butyric acid is 436.9±45.0 °C at 760 mmHg. |
| Q: What is the molecular weight of Boc-(R)-3-amino-4-(2-trifluoromethylphenyl)-butyric acid? |
| A: Molecular weight of Boc-(R)-3-amino-4-(2-trifluoromethylphenyl)-butyric acid is 347.329. |
| Q: What is the InChIKey of Boc-(R)-3-amino-4-(2-trifluoromethylphenyl)-butyric acid? |
| A: InChIKey of Boc-(R)-3-amino-4-(2-trifluoromethylphenyl)-butyric acid is YQJFIZXCXGBMPB-LLVKDONJSA-N. |
| Q: What is the polar surface area (PSA) of Boc-(R)-3-amino-4-(2-trifluoromethylphenyl)-butyric acid? |
| A: Polar surface area (PSA) of Boc-(R)-3-amino-4-(2-trifluoromethylphenyl)-butyric acid is 75.63000. |
| Q: What is the molecular formula of Boc-(R)-3-amino-4-(2-trifluoromethylphenyl)-butyric acid? |
| A: Molecular formula of Boc-(R)-3-amino-4-(2-trifluoromethylphenyl)-butyric acid is C16H20F3NO4. |
| Q: What is the English name of Boc-(R)-3-amino-4-(2-trifluoromethylphenyl)-butyric acid? |
| A: The English name of Boc-(R)-3-amino-4-(2-trifluoromethylphenyl)-butyric acid is Boc-(R)-3-amino-4-(2-trifluoromethylphenyl)-butyric acid. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |