1,2-bis(4,4,5,5-tetramethyl-[1,3,2]dioxabororan-2-yl)benzene structure
|
Common Name | 1,2-bis(4,4,5,5-tetramethyl-[1,3,2]dioxabororan-2-yl)benzene | ||
|---|---|---|---|---|
| CAS Number | 269410-07-3 | Molecular Weight | 330.03500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H28B2O4 | Melting Point | 114.0 to 118.0 °C | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,2-bis(4,4,5,5-tetramethyl-[1,3,2]dioxabororan-2-yl)benzene |
|---|
| Melting Point | 114.0 to 118.0 °C |
|---|---|
| Molecular Formula | C18H28B2O4 |
| Molecular Weight | 330.03500 |
| Exact Mass | 330.21700 |
| PSA | 36.92000 |
| LogP | 2.28500 |
| InChIKey | VCTMQXIOUDZIGS-UHFFFAOYSA-N |
| SMILES | CC1(C)OB(c2ccccc2B2OC(C)(C)C(C)(C)O2)OC1(C)C |