α-[(8-Hydroxy-5-quinolyl)imino]-4'-nitroacetophenone structure
|
Common Name | α-[(8-Hydroxy-5-quinolyl)imino]-4'-nitroacetophenone | ||
|---|---|---|---|---|
| CAS Number | 26942-56-3 | Molecular Weight | 321.28700 | |
| Density | 1.39g/cm3 | Boiling Point | 611ºC at 760 mmHg | |
| Molecular Formula | C17H11N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 323.3ºC | |
| Name | 2-(8-hydroxyquinolin-5-yl)imino-1-(4-nitrophenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 611ºC at 760 mmHg |
| Molecular Formula | C17H11N3O4 |
| Molecular Weight | 321.28700 |
| Flash Point | 323.3ºC |
| Exact Mass | 321.07500 |
| PSA | 108.37000 |
| LogP | 3.95700 |
| Vapour Pressure | 1.6E-15mmHg at 25°C |
| Index of Refraction | 1.677 |
| InChIKey | GHNUAEKYDHZZGW-UHFFFAOYSA-N |
| SMILES | O=C(C=Nc1ccc(O)c2ncccc12)c1ccc([N+](=O)[O-])cc1 |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(8-hydroxy-quinolin-5-ylimino)-1-(4-nitro-phenyl)-ethanone |
| 5-((p-Nitrobenzoyl)methylenamino)-8-quinolinol |
| 8-Quinolinol,5-((p-nitrobenzoyl)methylenamino) |
| 8-Quinolinol,5-((p-nitrophenyl)glyoxylidenamino) |
| 5-((p-Nitrophenyl)glyoxylidenamino)-8-quinolinol |