α-[(8-Hydroxy-5-quinolyl)imino]-4'-methylacetophenone structure
|
Common Name | α-[(8-Hydroxy-5-quinolyl)imino]-4'-methylacetophenone | ||
|---|---|---|---|---|
| CAS Number | 26942-57-4 | Molecular Weight | 290.31600 | |
| Density | 1.2g/cm3 | Boiling Point | 541ºC at 760 mmHg | |
| Molecular Formula | C18H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 281ºC | |
| Name | 2-(8-hydroxyquinolin-5-yl)imino-1-(4-methylphenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 541ºC at 760 mmHg |
| Molecular Formula | C18H14N2O2 |
| Molecular Weight | 290.31600 |
| Flash Point | 281ºC |
| Exact Mass | 290.10600 |
| PSA | 62.55000 |
| LogP | 3.83400 |
| Vapour Pressure | 2.57E-12mmHg at 25°C |
| Index of Refraction | 1.631 |
| InChIKey | OLRLYEDWHXAVAL-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)C=Nc2ccc(O)c3ncccc23)cc1 |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 8-Quinolinol,5-(p-tolylglyoxylidenamino) |
| 5-(p-Tolylglyoxylidenamino)-8-quinolinol |
| 8-Quinolinol,5-((p-methylbenzoyl)methylenamino) |
| 5-((p-Methylbenzoyl)methylenamino)-8-quinolinol |
| 2-(8-hydroxy-quinolin-5-ylimino)-1-p-tolyl-ethanone |