Boc-(R)-3-Amino-4-(3-trifluoromethylphenyl)-butyric acid structure
|
Common Name | Boc-(R)-3-Amino-4-(3-trifluoromethylphenyl)-butyric acid | ||
|---|---|---|---|---|
| CAS Number | 269726-74-1 | Molecular Weight | 347.33000 | |
| Density | 1.246g/cm3 | Boiling Point | 441.8ºC at 760mmHg | |
| Molecular Formula | C16H20F3NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221ºC | |
| Name | Boc-(R)-3-amino-4-(3-trifluoromethylphenyl)-butyric acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.246g/cm3 |
|---|---|
| Boiling Point | 441.8ºC at 760mmHg |
| Molecular Formula | C16H20F3NO4 |
| Molecular Weight | 347.33000 |
| Flash Point | 221ºC |
| Exact Mass | 347.13400 |
| PSA | 75.63000 |
| LogP | 4.00680 |
| Vapour Pressure | 1.39E-08mmHg at 25°C |
| Index of Refraction | 1.486 |
| InChIKey | ATUJVGXTABSYTK-GFCCVEGCSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC(=O)O)Cc1cccc(C(F)(F)F)c1 |
| Storage condition | 2-8°C |
| HS Code | 2924299090 |
|---|
|
~%
Boc-(R)-3-Amino... CAS#:269726-74-1 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 14, # 18 p. 4759 - 4762 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| boc-(r)-3-amino-4-(3-trifluoromethyl-phenyl)-butyric acid |
| MFCD01860969 |