1-methyl-4-phenylsulfanylsulfinylbenzene structure
|
Common Name | 1-methyl-4-phenylsulfanylsulfinylbenzene | ||
|---|---|---|---|---|
| CAS Number | 26974-30-1 | Molecular Weight | 248.36400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H12OS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-methyl-4-phenylsulfanylsulfinylbenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H12OS2 |
|---|---|
| Molecular Weight | 248.36400 |
| Exact Mass | 248.03300 |
| PSA | 61.58000 |
| LogP | 4.67560 |
| InChIKey | FOAIARNCIQYDBM-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)Sc2ccccc2)cc1 |
|
~39%
1-methyl-4-phen... CAS#:26974-30-1 |
| Literature: Noguchi; Isoda; Kuroki; Furukawa Chemical and Pharmaceutical Bulletin, 1982 , vol. 30, # 5 p. 1646 - 1652 |
|
~%
1-methyl-4-phen... CAS#:26974-30-1 |
| Literature: Khosla; Anand Journal of Scientific and Industrial Research, 1958 , vol. 17B, p. 71 |
|
~%
1-methyl-4-phen... CAS#:26974-30-1 |
| Literature: Backer; Kloosterziel Recueil des Travaux Chimiques des Pays-Bas, 1954 , vol. 73, p. 129,135 |
| Precursor 4 | |
|---|---|
| DownStream 5 | |
| 4-Methyl-benzolthiosulfinsaeure-S-phenylester |
| phenyl p-toluenethiolsulfinate |
| toluene-4-thiosulfinic acid S-phenyl ester |
| S-phenyl p-toluenethiosulfinate |
| Benzenesulfinothioic acid,4-methyl-,S-phenyl ester |
| Toluol-4-thiosulfinsaeure-S-phenylester |