Tert-butyl [4-(chlorosulfonyl)phenyl]carbamate structure
|
Common Name | Tert-butyl [4-(chlorosulfonyl)phenyl]carbamate | ||
|---|---|---|---|---|
| CAS Number | 269747-25-3 | Molecular Weight | 291.751 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 346.7±25.0 °C at 760 mmHg | |
| Molecular Formula | C11H14ClNO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 163.5±23.2 °C | |
| Name | tert-butyl N-(4-chlorosulfonylphenyl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 346.7±25.0 °C at 760 mmHg |
| Molecular Formula | C11H14ClNO4S |
| Molecular Weight | 291.751 |
| Flash Point | 163.5±23.2 °C |
| Exact Mass | 291.033203 |
| PSA | 80.85000 |
| LogP | 3.47 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.555 |
| InChIKey | XUKQJXYLFMTDNU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(S(=O)(=O)Cl)cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| QC-505 |
| RB3128 |
| Tert-butyl [4-(chlorosulfonyl)phenyl]carbamate |
| 2-Methyl-2-propanyl [4-(chlorosulfonyl)phenyl]carbamate |
| Carbamic acid, N-[4-(chlorosulfonyl)phenyl]-, 1,1-dimethylethyl ester |
| tert-Butyl (4-(chlorosulfonyl)phenyl)carbamate |