3-[1-[(2-chlorophenyl)methyl]-2-oxo-cyclopentyl]propanoic acid structure
|
Common Name | 3-[1-[(2-chlorophenyl)methyl]-2-oxo-cyclopentyl]propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 2700-13-2 | Molecular Weight | 280.74700 | |
| Density | 1.261g/cm3 | Boiling Point | 452.7ºC at 760mmHg | |
| Molecular Formula | C15H17ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 227.6ºC | |
| Name | 3-[1-[(2-chlorophenyl)methyl]-2-oxocyclopentyl]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.261g/cm3 |
|---|---|
| Boiling Point | 452.7ºC at 760mmHg |
| Molecular Formula | C15H17ClO3 |
| Molecular Weight | 280.74700 |
| Flash Point | 227.6ºC |
| Exact Mass | 280.08700 |
| PSA | 54.37000 |
| LogP | 3.48670 |
| Vapour Pressure | 5.54E-09mmHg at 25°C |
| Index of Refraction | 1.566 |
| InChIKey | CZNDPAXERIKZRR-UHFFFAOYSA-N |
| SMILES | O=C(O)CCC1(Cc2ccccc2Cl)CCCC1=O |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Cyclopentanepropionic acid,1-(o-chlorobenzyl)-2-oxo |
| 2-Oxo-1-(o-chlorbenzyl)-cyclopentylpropionsaeure |
| 1-(o-Chlorobenzyl)-2-oxocyclopentanepropionic acid |
| 3-<1-(2-Chlor-benzyl)-2-oxo-cyclopentyl>-propionsaeure |