(s)-3-amino-4-(4-iodophenyl)butanoic acid hydrochloride structure
|
Common Name | (s)-3-amino-4-(4-iodophenyl)butanoic acid hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 270065-70-8 | Molecular Weight | 341.573 | |
| Density | N/A | Boiling Point | 386.5ºC at 760mmHg | |
| Molecular Formula | C10H13ClINO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.6ºC | |
| Name | (3S)-3-amino-4-(4-iodophenyl)butanoic acid,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 386.5ºC at 760mmHg |
|---|---|
| Molecular Formula | C10H13ClINO2 |
| Molecular Weight | 341.573 |
| Flash Point | 187.6ºC |
| Exact Mass | 340.967926 |
| PSA | 63.32000 |
| LogP | 3.13800 |
| Vapour Pressure | 1.15E-06mmHg at 25°C |
| InChIKey | OEKGKNIRLMPHEI-FVGYRXGTSA-N |
| SMILES | Cl.NC(CC(=O)O)Cc1ccc(I)cc1 |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| (3S)-3-amino-4-(4-iodophenyl)butanoic Acid Hydrochloride |
| Benzenebutanoic acid, β-amino-4-iodo-, (βS)-, hydrochloride (1:1) |
| (S)-3-AMINO-4-(4-IODOPHENYL)BUTANOIC ACID HYDROCHLORIDE |
| (3S)-3-Amino-4-(4-iodophenyl)butanoic acid hydrochloride (1:1) |