G43-C3-TEG structure
|
Common Name | G43-C3-TEG | ||
|---|---|---|---|---|
| CAS Number | 2702262-15-3 | Molecular Weight | 533.55 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H27N3O9S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of G43-C3-TEGG43-C3-TEG is a glycosyl-transferase inhibitor. G43-C3-TEG reduces the biofilm formation by decreasing the production of EPS (extracellular polysaccharides)[1]. |
| Name | G43-C3-TEG |
|---|
| Description | G43-C3-TEG is a glycosyl-transferase inhibitor. G43-C3-TEG reduces the biofilm formation by decreasing the production of EPS (extracellular polysaccharides)[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C24H27N3O9S |
|---|---|
| Molecular Weight | 533.55 |
| InChIKey | HJFDUGQPVKRLDY-UHFFFAOYSA-N |
| SMILES | NC(=O)c1cc(OCCOCCOCCOCCO)ccc1NC(=O)c1cc2cc([N+](=O)[O-])ccc2s1 |