Cyclohexanecarboxylicacid, 5,5-dimethoxy-2-oxo-, methyl ester structure
|
Common Name | Cyclohexanecarboxylicacid, 5,5-dimethoxy-2-oxo-, methyl ester | ||
|---|---|---|---|---|
| CAS Number | 27024-78-8 | Molecular Weight | 216.23100 | |
| Density | 1.14g/cm3 | Boiling Point | 281.7ºC at 760 mmHg | |
| Molecular Formula | C10H16O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 128.1ºC | |
| Name | methyl 5,5-dimethoxy-2-oxocyclohexane-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 281.7ºC at 760 mmHg |
| Molecular Formula | C10H16O5 |
| Molecular Weight | 216.23100 |
| Flash Point | 128.1ºC |
| Exact Mass | 216.10000 |
| PSA | 61.83000 |
| LogP | 0.51770 |
| Vapour Pressure | 0.00352mmHg at 25°C |
| Index of Refraction | 1.458 |
| InChIKey | FDGVGVREYTUQJK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CC(OC)(OC)CCC1=O |
|
~%
Cyclohexanecarb... CAS#:27024-78-8 |
| Literature: Marshall,J.A.; Ruden,R.A. Journal of Organic Chemistry, 1971 , vol. 36, p. 594 - 596 |
| methyl 5,5-dimethoxy-2-oxocyclohexanecarboxylate |