phenyl (chloroformyl)phenylacetate structure
|
Common Name | phenyl (chloroformyl)phenylacetate | ||
|---|---|---|---|---|
| CAS Number | 27031-18-1 | Molecular Weight | 274.69900 | |
| Density | 1.282g/cm3 | Boiling Point | 418.5ºC at 760mmHg | |
| Molecular Formula | C15H11ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.1ºC | |
| Name | phenyl 3-chloro-3-oxo-2-phenylpropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.282g/cm3 |
|---|---|
| Boiling Point | 418.5ºC at 760mmHg |
| Molecular Formula | C15H11ClO3 |
| Molecular Weight | 274.69900 |
| Flash Point | 171.1ºC |
| Exact Mass | 274.04000 |
| PSA | 43.37000 |
| LogP | 3.14120 |
| Vapour Pressure | 3.26E-07mmHg at 25°C |
| Index of Refraction | 1.59 |
| InChIKey | MCVBDJMXSHYJAZ-UHFFFAOYSA-N |
| SMILES | O=C(Cl)C(C(=O)Oc1ccccc1)c1ccccc1 |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| EINECS 248-177-5 |
| Aceticacid,(chloroformyl)phenyl-,phenyl ester (8CI) |
| Benzeneacetic acid,a-(chlorocarbonyl)-,phenyl ester |
| Phenyl (chloroformyl)phenylacetate |
| chlorocarbonyl-phenyl-acetic acid phenyl ester |