1-[3-Bromo-4-(2,2,2-trifluoroethoxy)phenyl]ethan-1-amine hydrochloride
Modify Date: 2025-09-09 19:44:07
![1-[3-Bromo-4-(2,2,2-trifluoroethoxy)phenyl]ethan-1-amine hydrochloride Structure](https://www.chemsrc.com/extcaspic/063/2703779-89-7.png)
1-[3-Bromo-4-(2,2,2-trifluoroethoxy)phenyl]ethan-1-amine hydrochloride structure
|
Common Name | 1-[3-Bromo-4-(2,2,2-trifluoroethoxy)phenyl]ethan-1-amine hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 2703779-89-7 | Molecular Weight | 334.56 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H12BrClF3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-[3-Bromo-4-(2,2,2-trifluoroethoxy)phenyl]ethan-1-amine hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H12BrClF3NO |
|---|---|
| Molecular Weight | 334.56 |
| InChIKey | JODOWEPHXXLRLE-UHFFFAOYSA-N |
| SMILES | CC(N)c1ccc(OCC(F)(F)F)c(Br)c1.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 1-[3-Bromo-4-(2,2,2-trifluoroethoxy)phenyl]ethan-1-amine hydrochloride? |
| A: SMILES notation of 1-[3-Bromo-4-(2,2,2-trifluoroethoxy)phenyl]ethan-1-amine hydrochloride is CC(N)c1ccc(OCC(F)(F)F)c(Br)c1.Cl. |
| Q: What is the Chinese name of 2703779-89-7? |
| A: Chinese name of 2703779-89-7 is 2703779-89-7. |
| Q: What is the CAS number of 1-[3-Bromo-4-(2,2,2-trifluoroethoxy)phenyl]ethan-1-amine hydrochloride? |
| A: CAS number of 1-[3-Bromo-4-(2,2,2-trifluoroethoxy)phenyl]ethan-1-amine hydrochloride is 2703779-89-7. |
| Q: What is the molecular weight of 1-[3-Bromo-4-(2,2,2-trifluoroethoxy)phenyl]ethan-1-amine hydrochloride? |
| A: Molecular weight of 1-[3-Bromo-4-(2,2,2-trifluoroethoxy)phenyl]ethan-1-amine hydrochloride is 334.56. |
| Q: What is the InChIKey of 1-[3-Bromo-4-(2,2,2-trifluoroethoxy)phenyl]ethan-1-amine hydrochloride? |
| A: InChIKey of 1-[3-Bromo-4-(2,2,2-trifluoroethoxy)phenyl]ethan-1-amine hydrochloride is JODOWEPHXXLRLE-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1-[3-Bromo-4-(2,2,2-trifluoroethoxy)phenyl]ethan-1-amine hydrochloride? |
| A: Molecular formula of 1-[3-Bromo-4-(2,2,2-trifluoroethoxy)phenyl]ethan-1-amine hydrochloride is C10H12BrClF3NO. |
| Q: What is the English name of 1-[3-Bromo-4-(2,2,2-trifluoroethoxy)phenyl]ethan-1-amine hydrochloride? |
| A: The English name of 1-[3-Bromo-4-(2,2,2-trifluoroethoxy)phenyl]ethan-1-amine hydrochloride is 1-[3-Bromo-4-(2,2,2-trifluoroethoxy)phenyl]ethan-1-amine hydrochloride. |