2,2'-[(3-Acetamidophenyl)imino]diethyl diacetate structure
|
Common Name | 2,2'-[(3-Acetamidophenyl)imino]diethyl diacetate | ||
|---|---|---|---|---|
| CAS Number | 27059-08-1 | Molecular Weight | 322.35600 | |
| Density | 1.209 g/cm3 | Boiling Point | 511.7ºC at 760 mmHg | |
| Molecular Formula | C16H22N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 263.3ºC | |
| Name | 2-[3-acetamido-N-(2-acetyloxyethyl)anilino]ethyl acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.209 g/cm3 |
|---|---|
| Boiling Point | 511.7ºC at 760 mmHg |
| Molecular Formula | C16H22N2O5 |
| Molecular Weight | 322.35600 |
| Flash Point | 263.3ºC |
| Exact Mass | 322.15300 |
| PSA | 84.94000 |
| LogP | 1.65060 |
| Vapour Pressure | 1.39E-10mmHg at 25°C |
| Index of Refraction | 1.56 |
| InChIKey | QHMJTMSGRAGQMU-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1cccc(N(CCOC(C)=O)CCOC(C)=O)c1 |
| HS Code | 2924299090 |
|---|
|
~%
2,2'-[(3-Acetam... CAS#:27059-08-1 |
| Literature: Thiel, W.; Mayer, R.; Jauer, E.-A.; Modrow, H.; Dost, H. Journal fuer Praktische Chemie (Leipzig), 1986 , vol. 328, # 4 p. 497 - 514 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| einecs 248-196-9 |
| MFCD00035972 |