2-Pyridinecarbothioamide,N-(4-chlorophenyl)- structure
|
Common Name | 2-Pyridinecarbothioamide,N-(4-chlorophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 27060-28-2 | Molecular Weight | 248.73100 | |
| Density | 1.371g/cm3 | Boiling Point | 380ºC at 760mmHg | |
| Molecular Formula | C12H9ClN2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 183.6ºC | |
| Name | N-(4-chlorophenyl)pyridine-2-carbothioamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.371g/cm3 |
|---|---|
| Boiling Point | 380ºC at 760mmHg |
| Molecular Formula | C12H9ClN2S |
| Molecular Weight | 248.73100 |
| Flash Point | 183.6ºC |
| Exact Mass | 248.01700 |
| PSA | 57.01000 |
| LogP | 3.59560 |
| Vapour Pressure | 5.64E-06mmHg at 25°C |
| Index of Refraction | 1.712 |
| InChIKey | VXTYEGVJUVFYFH-UHFFFAOYSA-N |
| SMILES | S=C(Nc1ccc(Cl)cc1)c1ccccn1 |
| HS Code | 2933399090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4'-Chlorothiopicolinanilid |