[2-[[m-(Trifluoromethyl)phenethyl]oxy]ethyl]diethylamine structure
|
Common Name | [2-[[m-(Trifluoromethyl)phenethyl]oxy]ethyl]diethylamine | ||
|---|---|---|---|---|
| CAS Number | 27078-29-1 | Molecular Weight | 289.33600 | |
| Density | 1.077g/cm3 | Boiling Point | 303.5ºC at 760mmHg | |
| Molecular Formula | C15H22F3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 137.3ºC | |
| Name | N,N-diethyl-2-[2-[3-(trifluoromethyl)phenyl]ethoxy]ethanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.077g/cm3 |
|---|---|
| Boiling Point | 303.5ºC at 760mmHg |
| Molecular Formula | C15H22F3NO |
| Molecular Weight | 289.33600 |
| Flash Point | 137.3ºC |
| Exact Mass | 289.16500 |
| PSA | 12.47000 |
| LogP | 3.60630 |
| Vapour Pressure | 0.000929mmHg at 25°C |
| Index of Refraction | 1.463 |
| InChIKey | RIPLCRCVDMGJDS-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCOCCc1cccc(C(F)(F)F)c1 |
| HS Code | 2922199090 |
|---|
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Triethylamine,2-((m-(trifluoromethyl)phenethyl)oxy) |
| n,n-diethyl-2-{2-[3-(trifluoromethyl)phenyl]ethoxy}ethanamine |
| 2-((m-(Trifluoromethyl)phenethyl)oxy)triethylamine |