2-Amino-3-(3-fluoropyridin-2-YL)propanoic acid dihydrochloride
Modify Date: 2025-09-17 09:23:03
2-Amino-3-(3-fluoropyridin-2-YL)propanoic acid dihydrochloride structure
|
Common Name | 2-Amino-3-(3-fluoropyridin-2-YL)propanoic acid dihydrochloride | ||
|---|---|---|---|---|
| CAS Number | 2708278-77-5 | Molecular Weight | 257.09 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H11Cl2FN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Amino-3-(3-fluoropyridin-2-YL)propanoic acid dihydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H11Cl2FN2O2 |
|---|---|
| Molecular Weight | 257.09 |
| InChIKey | KCPIUOMBVHUJQL-UHFFFAOYSA-N |
| SMILES | Cl.Cl.NC(Cc1ncccc1F)C(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2-Amino-3-(3-fluoropyridin-2-YL)propanoic acid dihydrochloride? |
| A: SMILES notation of 2-Amino-3-(3-fluoropyridin-2-YL)propanoic acid dihydrochloride is Cl.Cl.NC(Cc1ncccc1F)C(=O)O. |
| Q: What is the InChIKey of 2-Amino-3-(3-fluoropyridin-2-YL)propanoic acid dihydrochloride? |
| A: InChIKey of 2-Amino-3-(3-fluoropyridin-2-YL)propanoic acid dihydrochloride is KCPIUOMBVHUJQL-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 2-Amino-3-(3-fluoropyridin-2-YL)propanoic acid dihydrochloride? |
| A: Molecular formula of 2-Amino-3-(3-fluoropyridin-2-YL)propanoic acid dihydrochloride is C8H11Cl2FN2O2. |
| Q: What is the English name of 2-Amino-3-(3-fluoropyridin-2-YL)propanoic acid dihydrochloride? |
| A: The English name of 2-Amino-3-(3-fluoropyridin-2-YL)propanoic acid dihydrochloride is 2-Amino-3-(3-fluoropyridin-2-YL)propanoic acid dihydrochloride. |
| Q: What is the Chinese name of 2708278-77-5? |
| A: Chinese name of 2708278-77-5 is 2708278-77-5. |
| Q: What is the CAS number of 2-Amino-3-(3-fluoropyridin-2-YL)propanoic acid dihydrochloride? |
| A: CAS number of 2-Amino-3-(3-fluoropyridin-2-YL)propanoic acid dihydrochloride is 2708278-77-5. |
| Q: What is the molecular weight of 2-Amino-3-(3-fluoropyridin-2-YL)propanoic acid dihydrochloride? |
| A: Molecular weight of 2-Amino-3-(3-fluoropyridin-2-YL)propanoic acid dihydrochloride is 257.09. |