2-Amino-2-(4-(difluoromethyl)-3-fluorophenyl)acetic acid hydrochloride
Modify Date: 2025-09-17 16:08:29
2-Amino-2-(4-(difluoromethyl)-3-fluorophenyl)acetic acid hydrochloride structure
|
Common Name | 2-Amino-2-(4-(difluoromethyl)-3-fluorophenyl)acetic acid hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 2708280-60-6 | Molecular Weight | 255.62 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H9ClF3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Amino-2-(4-(difluoromethyl)-3-fluorophenyl)acetic acid hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H9ClF3NO2 |
|---|---|
| Molecular Weight | 255.62 |
| InChIKey | PPIGGBKUFPZDGG-UHFFFAOYSA-N |
| SMILES | Cl.NC(C(=O)O)c1ccc(C(F)F)c(F)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2-Amino-2-(4-(difluoromethyl)-3-fluorophenyl)acetic acid hydrochloride? |
| A: CAS number of 2-Amino-2-(4-(difluoromethyl)-3-fluorophenyl)acetic acid hydrochloride is 2708280-60-6. |
| Q: What is the SMILES notation of 2-Amino-2-(4-(difluoromethyl)-3-fluorophenyl)acetic acid hydrochloride? |
| A: SMILES notation of 2-Amino-2-(4-(difluoromethyl)-3-fluorophenyl)acetic acid hydrochloride is Cl.NC(C(=O)O)c1ccc(C(F)F)c(F)c1. |
| Q: What is the molecular formula of 2-Amino-2-(4-(difluoromethyl)-3-fluorophenyl)acetic acid hydrochloride? |
| A: Molecular formula of 2-Amino-2-(4-(difluoromethyl)-3-fluorophenyl)acetic acid hydrochloride is C9H9ClF3NO2. |
| Q: What is the English name of 2-Amino-2-(4-(difluoromethyl)-3-fluorophenyl)acetic acid hydrochloride? |
| A: The English name of 2-Amino-2-(4-(difluoromethyl)-3-fluorophenyl)acetic acid hydrochloride is 2-Amino-2-(4-(difluoromethyl)-3-fluorophenyl)acetic acid hydrochloride. |
| Q: What is the molecular weight of 2-Amino-2-(4-(difluoromethyl)-3-fluorophenyl)acetic acid hydrochloride? |
| A: Molecular weight of 2-Amino-2-(4-(difluoromethyl)-3-fluorophenyl)acetic acid hydrochloride is 255.62. |
| Q: What is the InChIKey of 2-Amino-2-(4-(difluoromethyl)-3-fluorophenyl)acetic acid hydrochloride? |
| A: InChIKey of 2-Amino-2-(4-(difluoromethyl)-3-fluorophenyl)acetic acid hydrochloride is PPIGGBKUFPZDGG-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2708280-60-6? |
| A: Chinese name of 2708280-60-6 is 2708280-60-6. |