(S)-3-Amino-3-(2,2-difluorobenzo[D][1,3]dioxol-4-YL)propanoic acid hydrochloride structure
|
Common Name | (S)-3-Amino-3-(2,2-difluorobenzo[D][1,3]dioxol-4-YL)propanoic acid hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 2708340-99-0 | Molecular Weight | 281.64 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H10ClF2NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (S)-3-Amino-3-(2,2-difluorobenzo[D][1,3]dioxol-4-YL)propanoic acid hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H10ClF2NO4 |
|---|---|
| Molecular Weight | 281.64 |
| InChIKey | BZXWQHFLIHXKNA-RGMNGODLSA-N |
| SMILES | Cl.NC(CC(=O)O)c1cccc2c1OC(F)(F)O2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of (S)-3-Amino-3-(2,2-difluorobenzo[D][1,3]dioxol-4-YL)propanoic acid hydrochloride? |
| A: InChIKey of (S)-3-Amino-3-(2,2-difluorobenzo[D][1,3]dioxol-4-YL)propanoic acid hydrochloride is BZXWQHFLIHXKNA-RGMNGODLSA-N. |
| Q: What is the molecular formula of (S)-3-Amino-3-(2,2-difluorobenzo[D][1,3]dioxol-4-YL)propanoic acid hydrochloride? |
| A: Molecular formula of (S)-3-Amino-3-(2,2-difluorobenzo[D][1,3]dioxol-4-YL)propanoic acid hydrochloride is C10H10ClF2NO4. |
| Q: What is the CAS number of (S)-3-Amino-3-(2,2-difluorobenzo[D][1,3]dioxol-4-YL)propanoic acid hydrochloride? |
| A: CAS number of (S)-3-Amino-3-(2,2-difluorobenzo[D][1,3]dioxol-4-YL)propanoic acid hydrochloride is 2708340-99-0. |
| Q: What is the English name of (S)-3-Amino-3-(2,2-difluorobenzo[D][1,3]dioxol-4-YL)propanoic acid hydrochloride? |
| A: The English name of (S)-3-Amino-3-(2,2-difluorobenzo[D][1,3]dioxol-4-YL)propanoic acid hydrochloride is (S)-3-Amino-3-(2,2-difluorobenzo[D][1,3]dioxol-4-YL)propanoic acid hydrochloride. |
| Q: What is the Chinese name of 2708340-99-0? |
| A: Chinese name of 2708340-99-0 is 2708340-99-0. |
| Q: What is the SMILES notation of (S)-3-Amino-3-(2,2-difluorobenzo[D][1,3]dioxol-4-YL)propanoic acid hydrochloride? |
| A: SMILES notation of (S)-3-Amino-3-(2,2-difluorobenzo[D][1,3]dioxol-4-YL)propanoic acid hydrochloride is Cl.NC(CC(=O)O)c1cccc2c1OC(F)(F)O2. |
| Q: What is the molecular weight of (S)-3-Amino-3-(2,2-difluorobenzo[D][1,3]dioxol-4-YL)propanoic acid hydrochloride? |
| A: Molecular weight of (S)-3-Amino-3-(2,2-difluorobenzo[D][1,3]dioxol-4-YL)propanoic acid hydrochloride is 281.64. |