Ethyl (R)-8-amino-5,6,7,8-tetrahydronaphthalene-2-carboxylate hydrochloride
Modify Date: 2025-09-17 13:47:27
Ethyl (R)-8-amino-5,6,7,8-tetrahydronaphthalene-2-carboxylate hydrochloride structure
|
Common Name | Ethyl (R)-8-amino-5,6,7,8-tetrahydronaphthalene-2-carboxylate hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 2708341-04-0 | Molecular Weight | 255.74 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H18ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Ethyl (R)-8-amino-5,6,7,8-tetrahydronaphthalene-2-carboxylate hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H18ClNO2 |
|---|---|
| Molecular Weight | 255.74 |
| InChIKey | OMROZMRPAISMDG-UTONKHPSSA-N |
| SMILES | CCOC(=O)c1ccc2c(c1)C(N)CCC2.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Ethyl (R)-8-amino-5,6,7,8-tetrahydronaphthalene-2-carboxylate hydrochloride? |
| A: InChIKey of Ethyl (R)-8-amino-5,6,7,8-tetrahydronaphthalene-2-carboxylate hydrochloride is OMROZMRPAISMDG-UTONKHPSSA-N. |
| Q: What is the SMILES notation of Ethyl (R)-8-amino-5,6,7,8-tetrahydronaphthalene-2-carboxylate hydrochloride? |
| A: SMILES notation of Ethyl (R)-8-amino-5,6,7,8-tetrahydronaphthalene-2-carboxylate hydrochloride is CCOC(=O)c1ccc2c(c1)C(N)CCC2.Cl. |
| Q: What is the English name of Ethyl (R)-8-amino-5,6,7,8-tetrahydronaphthalene-2-carboxylate hydrochloride? |
| A: The English name of Ethyl (R)-8-amino-5,6,7,8-tetrahydronaphthalene-2-carboxylate hydrochloride is Ethyl (R)-8-amino-5,6,7,8-tetrahydronaphthalene-2-carboxylate hydrochloride. |
| Q: What is the molecular weight of Ethyl (R)-8-amino-5,6,7,8-tetrahydronaphthalene-2-carboxylate hydrochloride? |
| A: Molecular weight of Ethyl (R)-8-amino-5,6,7,8-tetrahydronaphthalene-2-carboxylate hydrochloride is 255.74. |
| Q: What is the CAS number of Ethyl (R)-8-amino-5,6,7,8-tetrahydronaphthalene-2-carboxylate hydrochloride? |
| A: CAS number of Ethyl (R)-8-amino-5,6,7,8-tetrahydronaphthalene-2-carboxylate hydrochloride is 2708341-04-0. |
| Q: What is the molecular formula of Ethyl (R)-8-amino-5,6,7,8-tetrahydronaphthalene-2-carboxylate hydrochloride? |
| A: Molecular formula of Ethyl (R)-8-amino-5,6,7,8-tetrahydronaphthalene-2-carboxylate hydrochloride is C13H18ClNO2. |
| Q: What is the Chinese name of 2708341-04-0? |
| A: Chinese name of 2708341-04-0 is 2708341-04-0. |